•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Metabolism

Set Ascending Direction

   

Items 31 to 40 of 64 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. Cilostazol; OPC 13013; OPC 21

    CAS No.: 73963-72-1
    Catalog No.: 131848
    Purity: 95%
    MF: C20H27N5O2
    MW: 369.469
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCC2=C(N1)C=CC(OCCCCC1=NN=NN1C1CCCCC1)=C2
  2. Iitraconazole; R51211

    CAS No.: 84625-61-6
    Catalog No.: 134610
    Purity: 95%
    MF: C35H38Cl2N8O4
    MW: 705.647
    Storage: 2-8 degree Celsius
    SMILES: CCC(C)N1N=CN(C1=O)C1=CC=C(C=C1)N1CCN(CC1)C1=CC=C(OC[C@H]2CO[C@@](CN3C=NC=N3)(O2)C2=CC=C(Cl)C=C2Cl)C=C1
  3. A77 1726

    CAS No.: 163451-81-8
    Catalog No.: 141738
    Purity: 95%
    MF: C12H9F3N2O2
    MW: 270.21
    Storage: 2-8 degree Celsius
    SMILES: CC(O)=C(C#N)C(=O)NC1=CC=C(C=C1)C(F)(F)F
  4. AG-636

    CAS No.: 1623416-31-8
    Catalog No.: 193690
    Purity: 95%
    MF: C21H17N3O2
    MW: 343.386
    Storage: 2-8 degree Celsius
    SMILES: CN1N=NC2=C1C(=CC(=C2)C2=CC=C(C=C2)C2=C(C=CC=C2)C)C(=O)O
  5. PKM2-IN-1

    CAS No.: 94164-88-2
    Catalog No.: 193714
    Purity: 95%
    MF: C18H19NO2S2
    MW: 345.489
    Storage: 2-8 degree Celsius
    SMILES: N1(CCCCC1)C(=S)SCC=1C(C2=CC=CC=C2C(C1C)=O)=O
  6. Alrestatin

    CAS No.: 51411-04-2
    Catalog No.: 193715
    Purity: 95%
    MF: C14H9NO4
    MW: 255.229
    Storage: 2-8 degree Celsius
    SMILES: O=C1N(C(C2=C3C(C=CC=C13)=CC=C2)=O)CC(=O)O
  7. BAY 2416964

    CAS No.: 2242464-44-2
    Catalog No.: 193721
    Purity: 95%
    MF: C18H18ClN5O3
    MW: 387.827
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=C1)C=1C=C(C(N(N1)C=1C=NN(C1)C)=O)C(=O)N[C@H](CO)C
  8. IACS-13909

    CAS No.: 2160546-07-4
    Catalog No.: 193731
    Purity: 95%
    MF: C17H18Cl2N6
    MW: 377.279
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=CC=C1Cl)C=1NN=C2N=C(C=NC21)N2CCC(CC2)(N)C
  9. A939572

    CAS No.: 1032229-33-6
    Catalog No.: 193755
    Purity: 95%
    MF: C20H22ClN3O3
    MW: 387.867
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(OC2CCN(CC2)C(=O)NC2=CC(=CC=C2)C(NC)=O)C=CC=C1
  10. 4,5-dichlorobenzene-1,3-disulfonamide

    CAS No.: 120-97-8
    Catalog No.: 102631
    Purity: 95%
    MF: C6H6Cl2N2O4S2
    MW: 305.164
    Storage: 2-8 degree Celsius
    SMILES: NS(=O)(=O)C1=CC(Cl)=C(Cl)C(=C1)S(N)(=O)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 64 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6