•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Metabolism

Set Ascending Direction

   

Items 1 to 10 of 64 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. AGI-6780; AGI6780; AGI 6780

    CAS No.: 1432660-47-3
    Catalog No.: 104342
    Purity: 95%
    MF: C21H18F3N3O3S2
    MW: 481.521
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=CC(NC(=O)NC2=CC(=CC=C2C2=CSC=C2)S(=O)(=O)NC2CC2)=CC=C1
  2. Epacadostat; INCN024360

    CAS No.: 1204669-58-8
    Catalog No.: 140120
    Purity: 95%
    MF: C11H13BrFN7O4S
    MW: 438.239
    Storage: 2-8 degree Celsius
    SMILES: NS(=O)(=O)NCCNC1=NON=C1\C(NC1=CC=C(F)C(Br)=C1)=N\O
  3. Methotrexate; Amethopterin; CL14377; WR19039

    CAS No.: 59-05-2
    Catalog No.: 141363
    Purity: 95%
    MF: C20H22N8O5
    MW: 454.447
    Storage: 2-8 degree Celsius
    SMILES: CN(CC1=NC2=C(N)N=C(N)N=C2N=C1)C1=CC=C(C=C1)C(=O)N[C@@H](CCC(O)=O)C(O)=O
  4. Diosmetin

    CAS No.: 520-34-3
    Catalog No.: 141551
    Purity: 95%
    MF: C16H12O6
    MW: 300.266
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(O)C=C(C=C1)C1=CC(=O)C2=C(O)C=C(O)C=C2O1
  5. Clofazimine

    CAS No.: 2030-63-9
    Catalog No.: 141719
    Purity: 95%
    MF: C27H22Cl2N4
    MW: 473.407
    Storage: 2-8 degree Celsius
    SMILES: CC(C)N=C1C=C2N(C3=CC=C(Cl)C=C3)C3=CC=CC=C3N=C2C=C1NC1=CC=C(Cl)C=C1
  6. Vardenafil HCl Trihydrate

    CAS No.: 330808-88-3
    Catalog No.: 151710
    Purity: 95%
    MF: C23H39ClN6O7S
    MW: 579.12
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].[H]O[H].[H]O[H].[H]O[H].CCCC1=NC(C)=C2N1NC(=NC2=O)C1=CC(=CC=C1OCC)S(=O)(=O)N1CCN(CC)CC1
  7. Fenspiride HCl

    CAS No.: 5053-08-7
    Catalog No.: 151871
    Purity: 95%
    MF: C15H21ClN2O2
    MW: 296.798
    Storage: 2-8 degree Celsius
    SMILES: Cl.O=C1NCC2(CCN(CCC3=CC=CC=C3)CC2)O1
  8. Liproxstatin-1

    CAS No.: 950455-15-9
    Catalog No.: 152063
    Purity: 95%
    MF: C19H21ClN4
    MW: 340.858
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC(CNC2=NC3=C(NC22CCNCC2)C=CC=C3)=CC=C1
  9. Orlistat

    CAS No.: 96829-58-2
    Catalog No.: 155823
    Purity: 95%
    MF: C29H53NO5
    MW: 495.745
    Storage: 2-8 degree Celsius
    SMILES: CCCCCCCCCCC[C@@H](C[C@@H]1OC(=O)[C@H]1CCCCCC)OC(=O)[C@H](CC(C)C)NC=O
  10. KPT-9274

    CAS No.: 1643913-93-2
    Catalog No.: 186149
    Purity: 95%
    MF: C35H29F3N4O3
    MW: 610.636
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=C(C=N1)/C=C/C(=O)NCC=1OC2=C(C1)C=C(C=C2C2=CC=C(C=C2)F)C2=CC=C(C=C2)C(=O)N2CCC(CC2)(F)F
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 64 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5