•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

MAPK

Set Ascending Direction

   

Items 31 to 37 of 37 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. GDC-0879

    CAS No.: 905281-76-7
    Catalog No.: 104912
    Purity: 95%
    MF: C19H18N4O2
    MW: 334.379
    Storage: 2-8 degree Celsius
    SMILES: OCCN1C=C(C(=N1)C1=CC=NC=C1)C1=CC2=C(C=C1)\C(CC2)=N\O
  2. SB202190; FHPI

    CAS No.: 152121-30-7
    Catalog No.: 106211
    Purity: 95%
    MF: C20H14FN3O
    MW: 331.35
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC=C(C=C1)C1=NC(=C(N1)C1=CC=NC=C1)C1=CC=C(F)C=C1
  3. TAK-632

    CAS No.: 1228591-30-7
    Catalog No.: 106215
    Purity: 95%
    MF: C27H18F4N4O3S
    MW: 554.525
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(OC2=CC=C3N=C(NC(=O)C4CC4)SC3=C2C#N)C=C1NC(=O)CC1=CC=CC(=C1)C(F)(F)F
  4. RAF265; CHIR-265

    CAS No.: 927880-90-8
    Catalog No.: 129032
    Purity: 95%
    MF: C24H16F6N6O
    MW: 518.421
    Storage: 2-8 degree Celsius
    SMILES: CN1C(NC2=CC=C(C=C2)C(F)(F)F)=NC2=CC(OC3=CC(=NC=C3)C3=NC=C(N3)C(F)(F)F)=CC=C12
  5. BIRB 796; Doramapimod

    CAS No.: 285983-48-4
    Catalog No.: 129033
    Purity: 95%
    MF: C31H37N5O3
    MW: 527.669
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=C1)N1N=C(C=C1NC(=O)NC1=CC=C(OCCN2CCOCC2)C2=CC=CC=C12)C(C)(C)C
  6. Ulixertinib; BVD-523; VRT752271

    CAS No.: 869886-67-9
    Catalog No.: 150956
    Purity: 95%
    MF: C21H22Cl2N4O2
    MW: 433.339
    Storage: 2-8 degree Celsius
    SMILES: CC(C)NC1=NC=C(Cl)C(=C1)C1=CNC(=C1)C(=O)N[C@H](CO)C1=CC(Cl)=CC=C1
  7. AS601245

    CAS No.: 345987-15-7
    Catalog No.: 150980
    Purity: 95%
    MF: C20H16N6S
    MW: 372.457
    Storage: 2-8 degree Celsius
    SMILES: N#CC(C1=NC2=CC=CC=C2S1)C1=CC=NC(NCCC2=CC=CN=C2)=N1
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 37 of 37 total

  1. 1
  2. 2
  3. 3
  4. 4