•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

JAK

Set Ascending Direction

   

Items 11 to 20 of 23 total

  1. 1
  2. 2
  3. 3
  1. Abrocitinib

    CAS No.: 1622902-68-4
    Catalog No.: ZB1566
    Purity: 95%
    MF: C14H21N5O2S
    MW: 323.41
    Storage: 2-8 degree Celsius
    SMILES: CCCS(=O)(N[C@H]1C[C@@H](N(C)C2=C3C(NC=C3)=NC=N2)C1)=O
  2. Golidocitinib(AZD4205)

    CAS No.: 2091134-68-6
    Catalog No.: 198909
    Purity: 95%
    MF: C25H31N9O2
    MW: 489.584
    Storage: 2-8 degree Celsius
    SMILES: COC1=NN(C=C1NC1=NC=CC(=N1)C1=CNC2=C(C=CC=C12)NC([C@@H](C)N1CCN(CC1)C)=O)C
  3. FM-381

    CAS No.: 2226521-65-7
    Catalog No.: TQR1213
    Purity: 95%
    MF: C24H24N6O2
    MW: 428.496
    Storage: 2-8 degree Celsius
    SMILES: C(#N)/C(/C(=O)N(C)C)=C\C=1OC(=CC1)C1=NC=2C(=C3C(=NC2)NC=C3)N1C1CCCCC1
  4. S-Ruxolitinib; INCB018424

    CAS No.: 941685-37-6
    Catalog No.: 150957
    Purity: 95%
    MF: C17H18N6
    MW: 306.373
    Storage: 2-8 degree Celsius
    SMILES: N#CC[C@@H](C1CCCC1)N1C=C(C=N1)C1=NC=NC2=C1C=CN2
  5. Decernotinib; VX-509

    CAS No.: 944842-54-0
    Catalog No.: 150958
    Purity: 95%
    MF: C18H19F3N6O
    MW: 392.385
    Storage: 2-8 degree Celsius
    SMILES: CC[C@@](C)(NC1=CC=NC(=N1)C1=CNC2=C1C=CC=N2)C(=O)NCC(F)(F)F
  6. XL019

    CAS No.: 945755-56-6
    Catalog No.: 106220
    Purity: 95%
    MF: C25H28N6O2
    MW: 444.539
    Storage: 2-8 degree Celsius
    SMILES: O=C(NC1=CC=C(C=C1)C1=NC(NC2=CC=C(C=C2)N2CCOCC2)=NC=C1)[C@@H]1CCCN1
  7. WP1066

    CAS No.: 857064-38-1
    Catalog No.: 104913
    Purity: 95%
    MF: C17H14BrN3O
    MW: 356.223
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](NC(=O)C(=C\C1=NC(Br)=CC=C1)\C#N)C1=CC=CC=C1
  8. Peficitinb; ASP015K; JNJ-54781532

    CAS No.: 944118-01-8
    Catalog No.: 152054
    Purity: 95%
    MF: C18H22N4O2
    MW: 326.4
    Storage: 2-8 degree Celsius
    SMILES: NC(=O)C1=C(N[C@@H]2[C@H]3C[C@H]4C[C@@H]2C[C@](O)(C4)C3)C2=C(NC=C2)N=C1
  9. Fedratinib; SAR302503; TG101348

    CAS No.: 936091-26-8
    Catalog No.: 111892
    Purity: 95%
    MF: C27H36N6O3S
    MW: 524.691
    Storage: 2-8 degree Celsius
    SMILES: CC1=CN=C(NC2=CC=C(OCCN3CCCC3)C=C2)N=C1NC1=CC(=CC=C1)S(=O)(=O)NC(C)(C)C
  10. Peficitinib hydrobromide

    CAS No.: 1353219-05-2
    Catalog No.: WLZ3779
    Purity: 95%
    MF: C18H23BrN4O2
    MW: 407.312
    Storage: 2-8 degree Celsius
    SMILES: Br.OC12CC3C(C(CC(C1)C3)C2)NC2=C3C(=NC=C2C(=O)N)NC=C3
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 23 total

  1. 1
  2. 2
  3. 3