•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

JAK

Set Descending Direction

   

Items 1 to 10 of 23 total

  1. 1
  2. 2
  3. 3
  1. C188-9

    CAS No.: 432001-19-9
    Catalog No.: 186827
    Purity: 95%
    MF: C27H21NO5S
    MW: 471.534
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(C=C(C2=CC=CC=C12)NS(=O)(=O)C1=CC=C(C=C1)OC)C1=C(C=CC2=CC=CC=C12)O
  2. Deucravacitinib (BMS-986165)

    CAS No.: 1609392-27-9
    Catalog No.: 193640
    Purity: 95%
    MF: C20H22N8O3
    MW: 422.449
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C(=O)NC1=CC(=C(N=N1)C(=O)NC)NC1=C(C(=CC=C1)C1=NN(C=N1)C)OC
  3. Ruxolitinib Phosphate; INCB018424 phosphate; INCB 018424 phosphate; INCB-018424 phosphate; Ruxolitinib

    CAS No.: 1092939-17-7
    Catalog No.: 133212
    Purity: 95%
    MF: C17H21N6O4P
    MW: 404.367
    Storage: 2-8 degree Celsius
    SMILES: OP(O)(O)=O.N#CC[C@H](C1CCCC1)N1C=C(C=N1)C1=C2C=CNC2=NC=N1
  4. BMS-911543

    CAS No.: 1271022-90-2
    Catalog No.: 131688
    Purity: 95%
    MF: C23H28N8O
    MW: 432.532
    Storage: 2-8 degree Celsius
    SMILES: CCN1C(=CC2=C3N(C)C=NC3=C(NC3=NN(C)C(C)=C3)N=C12)C(=O)N(C1CC1)C1CC1
  5. Filgotinib; GLPG0634

    CAS No.: 1206161-97-8
    Catalog No.: 112413
    Purity: 95%
    MF: C21H23N5O3S
    MW: 425.514
    Storage: 2-8 degree Celsius
    SMILES: O=C(NC1=NN2C(C=CC=C2C2=CC=C(CN3CCS(=O)(=O)CC3)C=C2)=N1)C1CC1
  6. Momelotinib; CYT387

    CAS No.: 1056634-68-4
    Catalog No.: 111935
    Purity: 95%
    MF: C23H22N6O2
    MW: 414.469
    Storage: 2-8 degree Celsius
    SMILES: O=C(NCC#N)C1=CC=C(C=C1)C1=NC(NC2=CC=C(C=C2)N2CCOCC2)=NC=C1
  7. Ruxolitinib; INCB018424

    CAS No.: 941678-49-5
    Catalog No.: 111879
    Purity: 95%
    MF: C17H18N6
    MW: 306.373
    Storage: 2-8 degree Celsius
    SMILES: N#CC[C@H](C1CCCC1)N1C=C(C=N1)C1=C2C=CNC2=NC=N1
  8. Tofacitinib (CP-690550) Citrate

    CAS No.: 540737-29-9
    Catalog No.: 111860
    Purity: 95%
    MF: C22H28N6O8
    MW: 504.5
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.C[C@@H]1CCN(C[C@@H]1N(C)C1=C2C=CNC2=NC=N1)C(=O)CC#N
  9. Tofacitinib; CP-690550; Tasocitinib; CK2 Inhibitor 10

    CAS No.: 477600-75-2
    Catalog No.: 104813
    Purity: 95%
    MF: C16H20N6O
    MW: 312.377
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H]1CCN(C[C@@H]1N(C)C1=C2C=CNC2=NC=N1)C(=O)CC#N
  10. AZD1480; AZD 1480; AZD-1480

    CAS No.: 935666-88-9
    Catalog No.: 101244
    Purity: 95%
    MF: C14H14ClFN8
    MW: 348.773
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](NC1=NC=C(Cl)C(NC2=NNC(C)=C2)=N1)C1=NC=C(F)C=N1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 23 total

  1. 1
  2. 2
  3. 3