•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

JAK/STAT

Set Ascending Direction

   

Items 1 to 10 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. Momelotinib; CYT387

    CAS No.: 1056634-68-4
    Catalog No.: 111935
    Purity: 95%
    MF: C23H22N6O2
    MW: 414.469
    Storage: 2-8 degree Celsius
    SMILES: O=C(NCC#N)C1=CC=C(C=C1)C1=NC(NC2=CC=C(C=C2)N2CCOCC2)=NC=C1
  2. C188-9

    CAS No.: 432001-19-9
    Catalog No.: 186827
    Purity: 95%
    MF: C27H21NO5S
    MW: 471.534
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(C=C(C2=CC=CC=C12)NS(=O)(=O)C1=CC=C(C=C1)OC)C1=C(C=CC2=CC=CC=C12)O
  3. Golidocitinib(AZD4205)

    CAS No.: 2091134-68-6
    Catalog No.: 198909
    Purity: 95%
    MF: C25H31N9O2
    MW: 489.584
    Storage: 2-8 degree Celsius
    SMILES: COC1=NN(C=C1NC1=NC=CC(=N1)C1=CNC2=C(C=CC=C12)NC([C@@H](C)N1CCN(CC1)C)=O)C
  4. Erlotinib HCl; CP-358774; OSI-774; NSC 718781

    CAS No.: 183319-69-9
    Catalog No.: 101009
    Purity: 95%
    MF: C22H24ClN3O4
    MW: 429.904
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].COCCOC1=CC2=NC=NC(NC3=CC=CC(=C3)C#C)=C2C=C1OCCOC
  5. AZD1480; AZD 1480; AZD-1480

    CAS No.: 935666-88-9
    Catalog No.: 101244
    Purity: 95%
    MF: C14H14ClFN8
    MW: 348.773
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](NC1=NC=C(Cl)C(NC2=NNC(C)=C2)=N1)C1=NC=C(F)C=N1
  6. Tofacitinib; CP-690550; Tasocitinib; CK2 Inhibitor 10

    CAS No.: 477600-75-2
    Catalog No.: 104813
    Purity: 95%
    MF: C16H20N6O
    MW: 312.377
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H]1CCN(C[C@@H]1N(C)C1=C2C=CNC2=NC=N1)C(=O)CC#N
  7. AZD1208; AZD-1208

    CAS No.: 1204144-28-4
    Catalog No.: 108247
    Purity: 95%
    MF: C21H21N3O2S
    MW: 379.485
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H]1CCCN(C1)C1=C(\C=C2/SC(=O)NC2=O)C=CC=C1C1=CC=CC=C1
  8. Tofacitinib (CP-690550) Citrate

    CAS No.: 540737-29-9
    Catalog No.: 111860
    Purity: 95%
    MF: C22H28N6O8
    MW: 504.5
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.C[C@@H]1CCN(C[C@@H]1N(C)C1=C2C=CNC2=NC=N1)C(=O)CC#N
  9. Ruxolitinib; INCB018424

    CAS No.: 941678-49-5
    Catalog No.: 111879
    Purity: 95%
    MF: C17H18N6
    MW: 306.373
    Storage: 2-8 degree Celsius
    SMILES: N#CC[C@H](C1CCCC1)N1C=C(C=N1)C1=C2C=CNC2=NC=N1
  10. PF06651600

    CAS No.: 1792180-81-4
    Catalog No.: 186375
    Purity: 95%
    MF: C15H19N5O
    MW: 285.351
    Storage: 2-8 degree Celsius
    SMILES: N1=CN=C(C2=C1NC=C2)N[C@@H]2CC[C@@H](N(C2)C(C=C)=O)C
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4