•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

JAK/STAT

Set Ascending Direction

   

Items 21 to 30 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. (Z)-SMI-4a

    CAS No.: 438190-29-5
    Catalog No.: 112433
    Purity: 95%
    MF: C11H6F3NO2S
    MW: 273.235
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=CC(\C=C2/SC(=O)NC2=O)=CC=C1
  2. Poziotinib; HM781-36B

    CAS No.: 1092364-38-9
    Catalog No.: 141917
    Purity: 95%
    MF: C23H21Cl2FN4O3
    MW: 491.35
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(OC2CCN(CC2)C(=O)C=C)C=C2C(NC3=C(F)C(Cl)=C(Cl)C=C3)=NC=NC2=C1
  3. (E/Z)-Zotiraciclib

    CAS No.: 937270-47-8
    Catalog No.: 169448
    Purity: 95%
    MF: C23H24N4O
    MW: 372.472
    Storage: 2-8 degree Celsius
    SMILES: CN1C\C=C\CCOC2=CC=CC(=C2)C2=CC=NC(NC3=CC=CC(C1)=C3)=N2
  4. Tesevatinib

    CAS No.: 781613-23-8
    Catalog No.: 169474
    Purity: 95%
    MF: C24H25Cl2FN4O2
    MW: 491.394
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12C[C@H](COC3=CC4=NC=NC(NC5=CC=C(Cl)C(Cl)=C5F)=C4C=C3OC)C[C@]1([H])CN(C)C2
  5. Filgotinib maleate

    CAS No.: 1802998-75-9
    Catalog No.: WLZ3770
    Purity: 95%
    MF: C25H27N5O7S
    MW: 541.586
    Storage: 2-8 degree Celsius
    SMILES: C(\C=C/C(=O)O)(=O)O.O=S1(CCN(CC1)CC1=CC=C(C=C1)C1=CC=CC=2N1N=C(N2)NC(=O)C2CC2)=O
  6. Peficitinib hydrobromide

    CAS No.: 1353219-05-2
    Catalog No.: WLZ3779
    Purity: 95%
    MF: C18H23BrN4O2
    MW: 407.312
    Storage: 2-8 degree Celsius
    SMILES: Br.OC12CC3C(C(CC(C1)C3)C2)NC2=C3C(=NC=C2C(=O)N)NC=C3
  7. AST-1306

    CAS No.: 897383-62-9
    Catalog No.: 101142
    Purity: 95%
    MF: C24H18ClFN4O2
    MW: 448.885
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC(COC2=CC=C(NC3=C4C=C(NC(=O)C=C)C=CC4=NC=N3)C=C2Cl)=CC=C1
  8. Peficitinb; ASP015K; JNJ-54781532

    CAS No.: 944118-01-8
    Catalog No.: 152054
    Purity: 95%
    MF: C18H22N4O2
    MW: 326.4
    Storage: 2-8 degree Celsius
    SMILES: NC(=O)C1=C(N[C@@H]2[C@H]3C[C@H]4C[C@@H]2C[C@](O)(C4)C3)C2=C(NC=C2)N=C1
  9. WP1066

    CAS No.: 857064-38-1
    Catalog No.: 104913
    Purity: 95%
    MF: C17H14BrN3O
    MW: 356.223
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](NC(=O)C(=C\C1=NC(Br)=CC=C1)\C#N)C1=CC=CC=C1
  10. XL019

    CAS No.: 945755-56-6
    Catalog No.: 106220
    Purity: 95%
    MF: C25H28N6O2
    MW: 444.539
    Storage: 2-8 degree Celsius
    SMILES: O=C(NC1=CC=C(C=C1)C1=NC(NC2=CC=C(C=C2)N2CCOCC2)=NC=C1)[C@@H]1CCCN1
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4