•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Isoquinolines

Set Ascending Direction

   

Items 31 to 40 of 502 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 8-chloroisoquinolin-6-amine

    CAS No.: 2204250-99-5
    Catalog No.: TQR1016
    Purity: 95%
    MF: C9H7ClN2
    MW: 178.622
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=C2C=CN=CC12)N
  2. 2-((1,2,3,4-tetrahydroisoquinolin-1-yl)methyl)isoindoline-1,3-dione

    CAS No.: 310451-86-6
    Catalog No.: TQR1114
    Purity: 95%
    MF: C18H16N2O2
    MW: 292.338
    Storage: 2-8 degree Celsius
    SMILES: C1(NCCC2=CC=CC=C12)CN1C(C2=CC=CC=C2C1=O)=O
  3. (1S,3R)-5-bromo-3-(((tert-butyldimethylsilyl)oxy)methyl)-1-methyl-1,2,3,4-tetrahydroisoquinoline

    CAS No.: 1638668-21-9
    Catalog No.: TQR1126
    Purity: 95%
    MF: C17H28BrNOSi
    MW: 370.407
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C[C@@H](N[C@H](C2=CC=C1)C)CO[Si](C)(C)C(C)(C)C
  4. (1S,3R)-5-bromo-3-(((tert-butyldimethylsilyl)oxy)methyl)-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride

    CAS No.: 1638668-28-6
    Catalog No.: TQR1127
    Purity: 95%
    MF: C17H29BrClNOSi
    MW: 406.868
    Storage: 2-8 degree Celsius
    SMILES: Cl.BrC1=C2C[C@@H](N[C@H](C2=CC=C1)C)CO[Si](C)(C)C(C)(C)C
  5. (R)-5-bromo-3-(((tert-butyldimethylsilyl)oxy)methyl)-1,2,3,4-tetrahydroisoquinoline

    CAS No.: 1638668-18-4
    Catalog No.: TQR1128
    Purity: 95%
    MF: C16H26BrNOSi
    MW: 356.38
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C[C@@H](NCC2=CC=C1)CO[Si](C)(C)C(C)(C)C
  6. 2-(2,6-dichlorophenyl)-1-((1S,3R)-5-(3-hydroxy-3-methylbutyl)-3-(hydroxymethyl)-1-methyl-3,4-dihydroisoquinolin-2(1H)-yl)ethanone

    CAS No.: 1638667-79-4
    Catalog No.: TQR1199
    Purity: 95%
    MF: C24H29Cl2NO3
    MW: 450.406
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C(=CC=C1)Cl)CC(=O)N1[C@H](C2=CC=CC(=C2C[C@@H]1CO)CCC(C)(C)O)C
    $13,260.00
  7. 4-((3,4-dihydroisoquinolin-2(1H)-yl)methyl)aniline

    CAS No.: 223438-28-6
    Catalog No.: TQR932
    Purity: 95%
    MF: C16H18N2
    MW: 238.334
    Storage: 2-8 degree Celsius
    SMILES: C1N(CCC2=CC=CC=C12)CC1=CC=C(N)C=C1
  8. 2-((2-(benzyloxy)-4-methoxy-6-methylpyridin-3-yl)methyl)-7-bromo-5,8-dichloro-3,4-dihydroisoquinolin-1(2H)-one

    CAS No.: 1844851-21-3
    Catalog No.: TQR979
    Purity: 95%
    MF: C24H21BrCl2N2O3
    MW: 536.253
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC1=NC(=CC(=C1CN1C(C2=C(C(=CC(=C2CC1)Cl)Br)Cl)=O)OC)C
  9. isoquinoline-5-carboxylic acid

    CAS No.: 27810-64-6
    Catalog No.: 103118
    Purity: 95%
    MF: C10H7NO2
    MW: 173.171
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=CC2=C1C=CN=C2
  10. 1-(isoquinolin-6-yl)propan-1-one

    CAS No.: 1053656-04-4
    Catalog No.: 103597
    Purity: 95%
    MF: C12H11NO
    MW: 185.226
    Storage: 2-8 degree Celsius
    SMILES: CCC(=O)C1=CC2=C(C=C1)C=NC=C2
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 502 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6