•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Isoquinolines

Set Ascending Direction

   

Items 11 to 20 of 502 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 7-bromo-6-methoxyisoquinoline

    CAS No.: 666735-07-5
    Catalog No.: TQR0174
    Purity: 95%
    MF: C10H8BrNO
    MW: 238.084
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C2C=CN=CC2=C1)OC
  2. (R)-1-(3-chloroisoquinolin-6-yl)ethanol

    CAS No.: 1381812-99-2
    Catalog No.: TQR0310
    Purity: 95%
    MF: C11H10ClNO
    MW: 207.66
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=CC2=CC=C(C=C2C1)[C@@H](C)O
  3. 1-(3-chloroisoquinolin-6-yl)ethanone

    CAS No.: 1381812-94-7
    Catalog No.: TQR0311
    Purity: 95%
    MF: C11H8ClNO
    MW: 205.644
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=CC2=CC=C(C=C2C1)C(C)=O
  4. (R)-tert-butyl (1-(3-chloroisoquinolin-6-yl)ethyl)carbamate

    CAS No.: 1510843-63-6
    Catalog No.: TQR0312
    Purity: 95%
    MF: C16H19ClN2O2
    MW: 306.793
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=CC2=CC=C(C=C2C1)[C@@H](C)NC(OC(C)(C)C)=O
  5. (R)-tert-butyl 3-(isoquinolin-1-ylamino)piperidine-1-carboxylate

    CAS No.: 1632251-03-6
    Catalog No.: TQR0561
    Purity: 95%
    MF: C19H25N3O2
    MW: 327.428
    Storage: 2-8 degree Celsius
    SMILES: C1(=NC=CC2=CC=CC=C12)N[C@H]1CN(CCC1)C(=O)OC(C)(C)C
  6. 7-bromo-3,8-dimethylisoquinolin-1(2H)-one

    CAS No.: 2244883-10-9
    Catalog No.: TQR0873
    Purity: 95%
    MF: C11H10BrNO
    MW: 252.111
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C2C=C(NC(C2=C1C)=O)C
  7. 7-bromo-3,6-dimethylisoquinolin-1(2H)-one

    CAS No.: 2245163-76-0
    Catalog No.: TQR0874
    Purity: 95%
    MF: C11H10BrNO
    MW: 252.111
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C2C=C(NC(C2=C1)=O)C)C
  8. 3,8-dimethyl-7-(quinolin-4-yl)isoquinolin-1(2H)-one

    CAS No.: 2244884-13-5
    Catalog No.: TQR0881
    Purity: 95%
    MF: C20H16N2O
    MW: 300.361
    Storage: 2-8 degree Celsius
    SMILES: CC=1NC(C2=C(C(=CC=C2C1)C1=CC=NC2=CC=CC=C12)C)=O
  9. (R)-2-tert-butyl 3-methyl 5-bromo-3,4-dihydroisoquinoline-2,3(1H)-dicarboxylate

    CAS No.: 1638668-16-2
    Catalog No.: TQR0890
    Purity: 95%
    MF: C16H20BrNO4
    MW: 370.243
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C[C@@H](N(CC2=CC=C1)C(=O)OC(C)(C)C)C(=O)OC
  10. 2-tert-butyl 3-methyl 5-bromo-3,4-dihydroisoquinoline-2,3(1H)-dicarboxylate

    CAS No.: 1454806-41-7
    Catalog No.: TQR0891
    Purity: 95%
    MF: C16H20BrNO4
    MW: 370.243
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2CC(N(CC2=CC=C1)C(=O)OC(C)(C)C)C(=O)OC
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 502 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5