•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Isoindolines

Set Ascending Direction

   

Items 61 to 70 of 422 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. 2-((4-((1,3-dioxoisoindolin-2-yl)methyl)-3-fluorophenyl)amino)-2-methylpropanoic acid

    CAS No.: NA
    Catalog No.: 197410
    Purity: 95%
    MF: C19H17FN2O4
    MW: 356.353
    Storage: 2-8 degree Celsius
    SMILES: O=C1N(C(C2=CC=CC=C12)=O)CC1=C(C=C(C=C1)NC(C(=O)O)(C)C)F
  2. 2-cyclopropyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid

    CAS No.: 356576-44-8
    Catalog No.: 197726
    Purity: 95%
    MF: C12H9NO4
    MW: 231.207
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)N1C(C2=CC=C(C=C2C1=O)C(=O)O)=O
  3. 2-(but-3-yn-1-yl)isoindoline-1,3-dione

    CAS No.: 14396-90-8
    Catalog No.: 197867
    Purity: 95%
    MF: C12H9NO2
    MW: 199.209
    Storage: 2-8 degree Celsius
    SMILES: C(CC#C)N1C(C=2C(C1=O)=CC=CC2)=O
  4. tert-butyl (S)-5-amino-4-(4-hydroxy-1-oxoisoindolin-2-yl)-5-oxopentanoate

    CAS No.: 1560678-51-4
    Catalog No.: 197868
    Purity: 95%
    MF: C17H22N2O5
    MW: 334.372
    Storage: 2-8 degree Celsius
    SMILES: NC([C@H](CCC(=O)OC(C)(C)C)N1C(C2=CC=CC(=C2C1)O)=O)=O
  5. tert-butyl 3-(2-(2-(2-((1,3-dioxoisoindolin-2-yl)oxy)ethoxy)ethoxy)ethoxy)propanoate

    CAS No.: 1807530-13-7
    Catalog No.: 197870
    Purity: 95%
    MF: C21H29NO8
    MW: 423.462
    Storage: 2-8 degree Celsius
    SMILES: O=C1N(C(C2=CC=CC=C12)=O)OCCOCCOCCOCCC(=O)OC(C)(C)C
  6. 1,3-dioxoisoindoline-5-carboxylicacid

    CAS No.: 20262-55-9
    Catalog No.: 197871
    Purity: 95%
    MF: C9H5NO4
    MW: 191.142
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC(C2=CC(=CC=C12)C(=O)O)=O
  7. perfluorophenyl 1-((1,3-dioxoisoindolin-2-yl)oxy)-3,6,9,12-tetraoxapentadecan-15-oate

    CAS No.: 2101206-46-4
    Catalog No.: 197872
    Purity: 95%
    MF: C25H24F5NO9
    MW: 577.455
    Storage: 2-8 degree Celsius
    SMILES: O=C1N(C(C2=CC=CC=C12)=O)OCCOCCOCCOCCOCCC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F
  8. perfluorophenyl 3-(2-(2-((1,3-dioxoisoindolin-2-yl)oxy)ethoxy)ethoxy)propanoate

    CAS No.: 2101206-47-5
    Catalog No.: 197873
    Purity: 95%
    MF: C21H16F5NO7
    MW: 489.349
    Storage: 2-8 degree Celsius
    SMILES: O=C1N(C(C2=CC=CC=C12)=O)OCCOCCOCCC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F
  9. 2-(2-(1H-imidazol-2-yl)ethyl)isoindoline-1,3-dione

    CAS No.: 88883-77-6
    Catalog No.: 197879
    Purity: 95%
    MF: C13H11N3O2
    MW: 241.25
    Storage: 2-8 degree Celsius
    SMILES: N1C(=NC=C1)CCN1C(C2=CC=CC=C2C1=O)=O
  10. 2-methylisoindolin-5-amine hydrochloride

    CAS No.: 943751-30-2
    Catalog No.: 197880
    Purity: 95%
    MF: C9H13ClN2
    MW: 184.67
    Storage: 2-8 degree Celsius
    SMILES: Cl.CN1CC2=CC=C(C=C2C1)N
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 422 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9