•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indolines

Set Ascending Direction

   

Items 61 to 70 of 179 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. 5-bromo-7-chloroindoline-2,3-dione

    CAS No.: 613656-97-6
    Catalog No.: HKP0049
    Purity: 95%
    MF: C8H3BrClNO2
    MW: 260.474
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(C(NC2=C(C1)Cl)=O)=O
  2. 5-bromo-7-methoxyindoline-2,3-dione

    CAS No.: 1360955-43-6
    Catalog No.: HKP0050
    Purity: 95%
    MF: C9H6BrNO3
    MW: 256.055
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(C(NC2=C(C1)OC)=O)=O
  3. 6-bromo-5,7-difluoroindoline-2,3-dione

    CAS No.: 1698027-85-8
    Catalog No.: HKP0051
    Purity: 95%
    MF: C8H2BrF2NO2
    MW: 262.009
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C2C(C(NC2=C1F)=O)=O)F
  4. 4-bromo-7-methoxyindoline-2,3-dione

    CAS No.: 67303-38-2
    Catalog No.: HKP0052
    Purity: 95%
    MF: C9H6BrNO3
    MW: 256.055
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C(C(NC2=C(C=C1)OC)=O)=O
  5. 5-bromo-7-fluoroindoline-2,3-dione

    CAS No.: 874830-75-8
    Catalog No.: HKP0053
    Purity: 95%
    MF: C8H3BrFNO2
    MW: 244.019
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(C(NC2=C(C1)F)=O)=O
  6. 6-bromo-7-chloroindoline-2,3-dione

    CAS No.: 1698027-53-0
    Catalog No.: HKP0054
    Purity: 95%
    MF: C8H3BrClNO2
    MW: 260.474
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C2C(C(NC2=C1Cl)=O)=O
  7. 5-bromo-7-isopropylindoline-2,3-dione

    CAS No.: 849630-82-6
    Catalog No.: HKP0055
    Purity: 95%
    MF: C11H10BrNO2
    MW: 268.11
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(C(NC2=C(C1)C(C)C)=O)=O
  8. 4-bromo-7-methylindoline-2,3-dione

    CAS No.: 874375-17-4
    Catalog No.: HKP0056
    Purity: 95%
    MF: C9H6BrNO2
    MW: 240.056
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C(C(NC2=C(C=C1)C)=O)=O
  9. 4-bromo-6-fluoro-7-methoxyindoline-2,3-dione

    CAS No.: 1616831-13-0
    Catalog No.: HKP0057
    Purity: 95%
    MF: C9H5BrFNO3
    MW: 274.045
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C(C(NC2=C(C(=C1)F)OC)=O)=O
  10. 4-bromo-7-chloroindoline-2,3-dione

    CAS No.: 1343103-76-3
    Catalog No.: HKP0058
    Purity: 95%
    MF: C8H3BrClNO2
    MW: 260.474
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C(C(NC2=C(C=C1)Cl)=O)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 179 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9