•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indoles

Set Ascending Direction

   

Items 1 to 10 of 768 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-nitro-1H-indole-3-carbaldehyde

    CAS No.: 10553-13-6
    Catalog No.: 193817
    Purity: 95%
    MF: C9H6N2O3
    MW: 190.158
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C2C(=CNC2=C1)C=O
  2. 3-(tert-butyl)-5-nitro-1H-indole

    CAS No.: 952664-67-4
    Catalog No.: TQP0480
    Purity: 95%
    MF: C12H14N2O2
    MW: 218.256
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)C1=CNC2=CC=C(C=C12)[N+](=O)[O-]
  3. 5-nitro-3-(tert-pentyl)-1H-indole

    CAS No.: 1926525-82-7
    Catalog No.: TQP0481
    Purity: 95%
    MF: C13H16N2O2
    MW: 232.283
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C=1C=C2C(=CNC2=CC1)C(C)(C)CC
  4. 5-bromo-3-(tert-butyl)-1H-indole

    CAS No.: 1161939-92-9
    Catalog No.: TQP0482
    Purity: 95%
    MF: C12H14BrN
    MW: 252.155
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(=CNC2=CC1)C(C)(C)C
  5. 5-bromo-3-(tert-pentyl)-1H-indole

    CAS No.: 1696358-95-8
    Catalog No.: TQP0483
    Purity: 95%
    MF: C13H16BrN
    MW: 266.182
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(=CNC2=CC1)C(C)(C)CC
  6. 5-bromo-3-(sec-butyl)-1H-indole

    CAS No.: 1693565-04-6
    Catalog No.: TQP0485
    Purity: 95%
    MF: C12H14BrN
    MW: 252.155
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(=CNC2=CC1)C(C)CC
  7. N-(3-(1-methylpiperidin-4-yl)-1H-indol-5-yl)acetamide

    CAS No.: 182563-03-7
    Catalog No.: TQP0486
    Purity: 95%
    MF: C16H21N3O
    MW: 271.364
    Storage: 2-8 degree Celsius
    SMILES: CN1CCC(CC1)C1=CNC2=CC=C(C=C12)NC(C)=O
  8. 3-(1-methyl-1,2,3,6-tetrahydropyridin-4-yl)-1H-indol-5-amine

    CAS No.: 116480-62-7
    Catalog No.: TQP0487
    Purity: 95%
    MF: C14H17N3
    MW: 227.311
    Storage: 2-8 degree Celsius
    SMILES: CN1CCC(=CC1)C1=CNC2=CC=C(C=C12)N
  9. tert-butyl 4-(5-amino-1H-indol-3-yl)piperidine-1-carboxylate

    CAS No.: 151273-40-4
    Catalog No.: TQP0488
    Purity: 95%
    MF: C18H25N3O2
    MW: 315.417
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=C2C(=CNC2=CC1)C1CCN(CC1)C(=O)OC(C)(C)C
  10. 3-(1-methylpyrrolidin-3-yl)-1H-indol-5-amine

    CAS No.: 156499-26-2
    Catalog No.: TQP0489
    Purity: 95%
    MF: C13H17N3
    MW: 215.3
    Storage: 2-8 degree Celsius
    SMILES: CN1CC(CC1)C1=CNC2=CC=C(C=C12)N
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 768 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5