•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indoles

Set Ascending Direction

   

Items 41 to 50 of 768 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 5-chloro-1-methyl-2-(6-phenylhexyl)-1H-indole

    CAS No.: 2020058-73-3
    Catalog No.: TQR0472
    Purity: 95%
    MF: C21H24ClN
    MW: 325.883
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C2C=C(N(C2=CC1)C)CCCCCCC1=CC=CC=C1
  2. ethyl 2-amino-6-(3,5-dimethylisoxazol-4-yl)-5-methoxy-1H-indole-3-carboxylate

    CAS No.: 1627721-54-3
    Catalog No.: TQR0507
    Purity: 95%
    MF: C17H19N3O4
    MW: 329.356
    Storage: 2-8 degree Celsius
    SMILES: NC=1NC2=CC(=C(C=C2C1C(=O)OCC)OC)C=1C(=NOC1C)C
  3. 6-methoxy-1-octyl-1H-indole

    CAS No.: 2099715-05-4
    Catalog No.: TQR0563
    Purity: 95%
    MF: C17H25NO
    MW: 259.393
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C2C=CN(C2=C1)CCCCCCCC
  4. 9-((6-methoxy-1-octyl-1H-indol-3-yl)methyl)-1,5-dioxa-9-azaspiro[5.5]undecane

    CAS No.: 2234279-79-7
    Catalog No.: TQR0564
    Purity: 95%
    MF: C26H40N2O3
    MW: 428.617
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C2C(=CN(C2=C1)CCCCCCCC)CN1CCC2(OCCCO2)CC1
  5. methyl 4-(1-(5-amino-1H-indol-3-yl)ethyl)-3-methoxybenzoate

    CAS No.: 107754-14-3
    Catalog No.: TQR0565
    Purity: 95%
    MF: C19H20N2O3
    MW: 324.38
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=C2C(=CNC2=CC1)C(C)C1=C(C=C(C(=O)OC)C=C1)OC
  6. 1-(phenylsulfonyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole

    CAS No.: 1334950-73-0
    Catalog No.: TQR0846
    Purity: 95%
    MF: C20H22BNO4S
    MW: 383.278
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)S(=O)(=O)N1C=CC2=C(C=CC=C12)B1OC(C(O1)(C)C)(C)C
  7. methyl 2-amino-6-(3,5-dimethylisoxazol-4-yl)-5-methoxy-1H-indole-3-carboxylate

    CAS No.: 2093392-64-2
    Catalog No.: TQR1033
    Purity: 95%
    MF: C16H17N3O4
    MW: 315.329
    Storage: 2-8 degree Celsius
    SMILES: NC=1NC2=CC(=C(C=C2C1C(=O)OC)OC)C=1C(=NOC1C)C
  8. methyl 4,5-dichloro-6-methyl-1H-indole-2-carboxylate

    CAS No.: 2244453-83-4
    Catalog No.: TQR1115
    Purity: 95%
    MF: C11H9Cl2NO2
    MW: 258.104
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2C=C(NC2=CC(=C1Cl)C)C(=O)OC
  9. methyl 4,5-dichloro-1,6-dimethyl-1H-indole-2-carboxylate

    CAS No.: 2244453-95-8
    Catalog No.: TQR1116
    Purity: 95%
    MF: C12H11Cl2NO2
    MW: 272.131
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2C=C(N(C2=CC(=C1Cl)C)C)C(=O)OC
  10. 3-bromo-7-fluoro-1-tosyl-1H-indole

    CAS No.: 887338-54-7
    Catalog No.: TQR1259
    Purity: 95%
    MF: C15H11BrFNO2S
    MW: 368.227
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CN(C2=C(C=CC=C12)F)S(=O)(=O)C1=CC=C(C)C=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 768 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7