•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indenes

Set Ascending Direction

   

Items 41 to 50 of 158 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 4-chloro-6-methoxy-1-indanone

    CAS No.: 1092347-56-2
    Catalog No.: WLZ3238
    Purity: 95%
    MF: C10H9ClO2
    MW: 196.633
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2CCC(C2=CC(=C1)OC)=O
  2. 4-chloro-7-fluoro-2,3-dihydro-1H-inden-1-one

    CAS No.: 1260018-63-0
    Catalog No.: WLZ3240
    Purity: 95%
    MF: C9H6ClFO
    MW: 184.597
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCC2=C1C(F)=CC=C2Cl
  3. 5-bromo-7-chloro-1-indanone

    CAS No.: 1273611-01-0
    Catalog No.: WLZ3243
    Purity: 95%
    MF: C9H6BrClO
    MW: 245.503
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2CCC(C2=C(C1)Cl)=O
  4. 6-bromo-4-chloro-1-indanone

    CAS No.: 1260017-17-1
    Catalog No.: WLZ3246
    Purity: 95%
    MF: C9H6BrClO
    MW: 245.503
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC(=C2CCC(C2=C1)=O)Cl
  5. 5-bromo-6-chloro-1-indanone

    CAS No.: 1260018-10-7
    Catalog No.: WLZ3251
    Purity: 95%
    MF: C9H6BrClO
    MW: 245.503
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2CCC(C2=CC1Cl)=O
  6. 4-fluoro-2-methyl-1-indanone

    CAS No.: 52045-42-8
    Catalog No.: WLZ3252
    Purity: 95%
    MF: C10H9FO
    MW: 164.179
    Storage: 2-8 degree Celsius
    SMILES: FC1=C2CC(C(C2=CC=C1)=O)C
  7. 2,6-dimethyl-1-indanone

    CAS No.: 66309-83-9
    Catalog No.: WLZ3254
    Purity: 95%
    MF: C11H12O
    MW: 160.216
    Storage: 2-8 degree Celsius
    SMILES: CC1C(C2=CC(=CC=C2C1)C)=O
  8. 6-chloro-7-bromoindanone

    CAS No.: 1336955-84-0
    Catalog No.: WLZ3255
    Purity: 95%
    MF: C9H6BrClO
    MW: 245.503
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2CCC(C2=C1Br)=O
  9. 7-bromo-5-hydroxy-1-indanone

    CAS No.: 1199783-02-2
    Catalog No.: WLZ3273
    Purity: 95%
    MF: C9H7BrO2
    MW: 227.057
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C=C2CCC(C12)=O)O
  10. 7-bromo-5-methoxy-1-indanone

    CAS No.: 1003048-74-5
    Catalog No.: WLZ3275
    Purity: 95%
    MF: C10H9BrO2
    MW: 241.084
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C=C2CCC(C12)=O)OC
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 158 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7