•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indenes

Set Ascending Direction

   

Items 31 to 40 of 158 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 1,1,3-trimethyl-2,3-dihydro-1H-inden-4-amine

    CAS No.: 94568-76-0
    Catalog No.: 166345
    Purity: 95%
    MF: C12H17N
    MW: 175.275
    Storage: 2-8 degree Celsius
    SMILES: CC1CC(C)(C)C2=CC=CC(N)=C12
  2. 7-amino-2,3-dihydroinden-1-one

    CAS No.: 628732-03-6
    Catalog No.: 182403
    Purity: 95%
    MF: C9H9NO
    MW: 147.177
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2C(=O)CCC2=CC=C1
  3. (R)-3-amino-2,3-dihydro-1H-inden-5-ol hydrochloride

    CAS No.: 169105-03-7
    Catalog No.: 190021
    Purity: 95%
    MF: C9H12ClNO
    MW: 185.654
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@@H]1CCC2=CC=C(C=C12)O
  4. methyl 4-methyl-1-oxo-2,3-dihydro-1H-indene-5-carboxylate

    CAS No.: 943845-12-3
    Catalog No.: 192231
    Purity: 95%
    MF: C12H12O3
    MW: 204.225
    Storage: 2-8 degree Celsius
    SMILES: CC1=C2CCC(C2=CC=C1C(=O)OC)=O
  5. 5-bromo-6-methoxy-2,3-dihydro-1H-inden-1-one

    CAS No.: 187872-11-3
    Catalog No.: 199471
    Purity: 95%
    MF: C10H9BrO2
    MW: 241.084
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2CCC(C2=CC1OC)=O
  6. 5-bromo-4-fluoro-2,3-dihydro-1H-inden-1-one

    CAS No.: 127425-74-5
    Catalog No.: WLZ3229
    Purity: 95%
    MF: C9H6BrFO
    MW: 229.048
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=C2CCC(C2=CC1)=O)F
  7. 3-oxo-2,3-dihydro-1H-indene-5-carbonitrile

    CAS No.: 69975-66-2
    Catalog No.: WLZ3232
    Purity: 95%
    MF: C10H7NO
    MW: 157.172
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCC2=CC=C(C=C12)C#N
  8. 2,3-dihydro-2-methyl-1H-inden-1-one

    CAS No.: 17496-14-9
    Catalog No.: WLZ3235
    Purity: 95%
    MF: C10H10O
    MW: 146.189
    Storage: 2-8 degree Celsius
    SMILES: CC1C(C2=CC=CC=C2C1)=O
  9. 4,7-dichloro-1-indanone

    CAS No.: 52977-63-6
    Catalog No.: WLZ3236
    Purity: 95%
    MF: C9H6Cl2O
    MW: 201.052
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2CCC(C2=C(C=C1)Cl)=O
  10. 4-bromo-7-chloro-1-indanone

    CAS No.: 1260013-03-3
    Catalog No.: WLZ3237
    Purity: 95%
    MF: C9H6BrClO
    MW: 245.503
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2CCC(C2=C(C=C1)Cl)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 158 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6