•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indazoles

Set Ascending Direction

   

Items 31 to 40 of 405 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 3-bromo-1H-indazole

    CAS No.: 40598-94-5
    Catalog No.: 107592
    Purity: 95%
    MF: C7H5BrN2
    MW: 197.035
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NNC2=C1C=CC=C2
  2. 3-bromo-5-methoxy-1H-indazole

    CAS No.: 885519-30-2
    Catalog No.: 107593
    Purity: 95%
    MF: C8H7BrN2O
    MW: 227.061
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(NN=C2Br)C=C1
  3. 3-chloro-1H-indazol-6-amine

    CAS No.: 21413-23-0
    Catalog No.: 107595
    Purity: 95%
    MF: C7H6ClN3
    MW: 167.599
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC2=C(C=C1)C(Cl)=NN2
  4. 3-chloro-5-nitro-1H-indazole

    CAS No.: 4812-45-7
    Catalog No.: 107596
    Purity: 95%
    MF: C7H4ClN3O2
    MW: 197.581
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC2=C(NN=C2Cl)C=C1
  5. 3-iodo-5-nitro-1H-indazole

    CAS No.: 70315-69-4
    Catalog No.: 107597
    Purity: 95%
    MF: C7H4IN3O2
    MW: 289.032
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC2=C(NN=C2I)C=C1
  6. 3-methyl-1H-indazole

    CAS No.: 3176-62-3
    Catalog No.: 107598
    Purity: 95%
    MF: C8H8N2
    MW: 132.166
    Storage: 2-8 degree Celsius
    SMILES: CC1=NNC2=C1C=CC=C2
  7. 5-chloro-1H-indazole-3-carbaldehyde

    CAS No.: 102735-84-2
    Catalog No.: 107600
    Purity: 95%
    MF: C8H5ClN2O
    MW: 180.594
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(NN=C2C=O)C=C1
  8. 5-methoxy-1H-indazole-3-carboxylic acid

    CAS No.: 90417-53-1
    Catalog No.: 107603
    Purity: 95%
    MF: C9H8N2O3
    MW: 192.174
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(NN=C2C(O)=O)C=C1
  9. 6-nitro-1H-indazole

    CAS No.: 7597-18-4
    Catalog No.: 107604
    Purity: 95%
    MF: C7H5N3O2
    MW: 163.136
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC2=C(C=NN2)C=C1
  10. ethyl 1H-indazole-3-carboxylate

    CAS No.: 4498-68-4
    Catalog No.: 107605
    Purity: 95%
    MF: C10H10N2O2
    MW: 190.202
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=NNC2=C1C=CC=C2
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 405 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6