•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Imidazopyrimidines

Set Ascending Direction

   

Items 31 to 33 of 33 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 5-chloro-8-iodoimidazo[1,2-c]pyrimidine

    CAS No.: 2374134-99-1
    Catalog No.: GS3965
    Purity: 95%
    MF: C6H3ClIN3
    MW: 279.468
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C(C=2N1C=CN2)I
  2. 8-bromo-5-chloroimidazo[1,2-c]pyrimidine

    CAS No.: 2095237-01-5
    Catalog No.: GS3964
    Purity: 95%
    MF: C6H3BrClN3
    MW: 232.468
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=2N(C(=NC1)Cl)C=CN2
  3. ethyl imidazo[1,2-a]pyrimidine-6-carboxylate

    CAS No.: 944906-58-5
    Catalog No.: 196111
    Purity: 95%
    MF: C9H9N3O2
    MW: 191.19
    Storage: 2-8 degree Celsius
    SMILES: N=1C=CN2C1N=CC(=C2)C(=O)OCC
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 33 of 33 total

  1. 1
  2. 2
  3. 3
  4. 4