•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Imidazopyrimidines

Set Ascending Direction

   

Items 11 to 20 of 33 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 3-bromoimidazo[1,2-a]pyrimidine

    CAS No.: 6840-45-5
    Catalog No.: 124224
    Purity: 95%
    MF: C6H4BrN3
    MW: 198.023
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CN=C2N=CC=CN12
  2. 8-bromoimidazo[1,2-c]pyrimidine

    CAS No.: 1049001-84-4
    Catalog No.: 185233
    Purity: 95%
    MF: C6H4BrN3
    MW: 198.023
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CN=CN2C=CN=C12
  3. 2-chloroimidazo[1,2-a]pyrimidine

    CAS No.: 189115-89-7
    Catalog No.: 186593
    Purity: 90%
    MF: C6H4ClN3
    MW: 153.572
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=C2N(C=CC=N2)C1
  4. 2-(4-chlorophenyl)-Imidazo[1,2-a]pyrimidine

    CAS No.: 56921-86-9
    Catalog No.: 186807
    Purity: 95%
    MF: C12H8ClN3
    MW: 229.67
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=C1)C=1N=C2N(C=CC=N2)C1
  5. 6-bromo-3-chloroimidazo[1,2-a]pyrimidine

    CAS No.: 1019025-49-0
    Catalog No.: 187343
    Purity: 95%
    MF: C6H3BrClN3
    MW: 232.468
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=NC=2N(C1)C(=CN2)Cl
  6. 7-methylimidazo[1,2-c]pyrimidin-5-ol hydrobromide

    CAS No.: NA
    Catalog No.: 197759
    Purity: 95%
    MF: C7H8BrN3O
    MW: 230.065
    Storage: 2-8 degree Celsius
    SMILES: Br.CC1=CC=2N(C(=N1)O)C=CN2
  7. imidazo[1,2-c]pyrimidin-5(6H)-one

    CAS No.: 55662-66-3
    Catalog No.: WLZ2593
    Purity: 95%
    MF: C6H5N3O
    MW: 135.126
    Storage: 2-8 degree Celsius
    SMILES: N=1C=CN2C(NC=CC21)=O
  8. imidazo[1,2-a]pyrimidine

    CAS No.: 274-95-3
    Catalog No.: 111000
    Purity: 95%
    MF: C6H5N3
    MW: 119.127
    Storage: 2-8 degree Celsius
    SMILES: C1=CN2C=CC=NC2=N1
  9. 7-chloroimidazo[1,2-c]pyrimidine

    CAS No.: 55662-71-0
    Catalog No.: 148829
    Purity: 95%
    MF: C6H4ClN3
    MW: 153.572
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=NC=CN2C=N1
  10. 7-chloroimidazo[1,2-a]pyrimidin-5(1H)-one

    CAS No.: 57473-33-3
    Catalog No.: 138158
    Purity: 95%
    MF: C6H4ClN3O
    MW: 169.571
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC(=O)N2C=CNC2=N1
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 33 total

  1. 1
  2. 2
  3. 3
  4. 4