•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Imidazopyridines

Set Ascending Direction

   

Items 1 to 10 of 275 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-chloro-1H-imidazo[4,5-c]pyridin-2(3H)-one

    CAS No.: 7205-43-8
    Catalog No.: TQP0530
    Purity: 95%
    MF: C6H4ClN3O
    MW: 169.571
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(C=N1)NC(N2)=O
  2. 6-chloro-2-(methylthio)-3H-imidazo[4,5-c]pyridine

    CAS No.: 7205-44-9
    Catalog No.: TQP0533
    Purity: 95%
    MF: C7H6ClN3S
    MW: 199.666
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(C=N1)NC(=N2)SC
  3. 6-chloro-1H-imidazo[4,5-c]pyridine-2(3H)-thione

    CAS No.: 7239-79-4
    Catalog No.: TQP0538
    Purity: 95%
    MF: C6H4ClN3S
    MW: 185.639
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(C=N1)NC(N2)=S
  4. 2-methylimidazo[1,2-a]pyridin-6-amine

    CAS No.: 860258-05-5
    Catalog No.: TQR0645
    Purity: 95%
    MF: C8H9N3
    MW: 147.181
    Storage: 2-8 degree Celsius
    SMILES: CC=1N=C2N(C=C(C=C2)N)C1
  5. 2-(4-fluorophenyl)imidazo[1,2-a]pyridin-6-amine

    CAS No.: 1018508-70-7
    Catalog No.: TQR0646
    Purity: 95%
    MF: C13H10FN3
    MW: 227.242
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)C=1N=C2N(C=C(C=C2)N)C1
  6. 2-(4-bromophenyl)imidazo[1,2-a]pyridin-6-amine

    CAS No.: 885950-52-7
    Catalog No.: TQR0647
    Purity: 95%
    MF: C13H10BrN3
    MW: 288.148
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C=1N=C2N(C=C(C=C2)N)C1
  7. 2-(4-bromophenyl)-6-nitroimidazo[1,2-a]pyridine

    CAS No.: 118000-56-9
    Catalog No.: TQR0648
    Purity: 95%
    MF: C13H8BrN3O2
    MW: 318.13
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C=1N=C2N(C=C(C=C2)[N+](=O)[O-])C1
  8. ethyl 1-isopropylimidazo[1,5-a]pyridine-3-carboxylate

    CAS No.: 2231103-72-1
    Catalog No.: TQR0665
    Purity: 95%
    MF: C13H16N2O2
    MW: 232.283
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C=1N=C(N2C1C=CC=C2)C(=O)OCC
  9. 2-isopropylimidazo[1,2-a]pyridine-8-carboxylic acid

    CAS No.: 133427-14-2
    Catalog No.: TQR0666
    Purity: 95%
    MF: C11H12N2O2
    MW: 204.229
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C=1N=C2N(C=CC=C2C(=O)O)C1
  10. 2-isopropylimidazo[1,2-a]pyridine-8-carbohydrazide

    CAS No.: 2231091-53-3
    Catalog No.: TQR0670
    Purity: 95%
    MF: C11H14N4O
    MW: 218.26
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C=1N=C2N(C=CC=C2C(=O)NN)C1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 275 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5