•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Imidazopyridazines

Set Ascending Direction

   

Items 1 to 10 of 25 total

  1. 1
  2. 2
  3. 3
  1. ethyl 2-(6-chloro-8-methylimidazo[1,2-b]pyridazin-2-yl)acetate

    CAS No.: 64068-01-5
    Catalog No.: TQP2999
    Purity: 95%
    MF: C11H12ClN3O2
    MW: 253.689
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=2N(N1)C=C(N2)CC(=O)OCC)C
  2. 6-chloro-2,7-dimethylimidazo[1,2-b]pyridazine

    CAS No.: 17412-20-3
    Catalog No.: 193383
    Purity: 95%
    MF: C8H8ClN3
    MW: 181.626
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C(=CC=2N(N1)C=C(N2)C)C
  3. 4,7-dichloro-1H-imidazo[4,5-d]pyridazine

    CAS No.: 17998-43-5
    Catalog No.: 106401
    Purity: 95%
    MF: C5H2Cl2N4
    MW: 189.005
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NN=C(Cl)C2=C1NC=N2
  4. 3-bromo-6-chloroimidazo[1,2-b]pyridazine

    CAS No.: 13526-66-4
    Catalog No.: 101234
    Purity: 95%
    MF: C6H3BrClN3
    MW: 232.468
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NN2C(Br)=CN=C2C=C1
  5. 6-bromo-2,8-dimethylimidazo[1,2-b]pyridazine

    CAS No.: 2361635-74-5
    Catalog No.: ZB1824
    Purity: 95%
    MF: C8H8BrN3
    MW: 226.077
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C=2N(N1)C=C(N2)C)C
  6. 6-chloro-2,8-dimethyl-imidazo[1,2-b]pyridazine

    CAS No.: 17412-23-6
    Catalog No.: TQR0466
    Purity: 95%
    MF: C8H8ClN3
    MW: 181.626
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=2N(N1)C=C(N2)C)C
  7. ethyl 2-cyclopropylimidazo[1,2-b]pyridazine-8-carboxylate

    CAS No.: 2227317-40-8
    Catalog No.: 197575
    Purity: 95%
    MF: C12H13N3O2
    MW: 231.255
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C=1N=C2N(N=CC=C2C(=O)OCC)C1
  8. 3-(imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoic acid

    CAS No.: 1300690-48-5
    Catalog No.: 171193
    Purity: 95%
    MF: C16H11N3O2
    MW: 277.283
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C=C(C=C1)C(O)=O)C#CC1=CN=C2C=CC=NN12
  9. ethyl 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate hydrochloride

    CAS No.: 623906-17-2
    Catalog No.: 137896
    Purity: 95%
    MF: C9H14ClN3O2
    MW: 231.683
    Storage: 2-8 degree Celsius
    SMILES: Cl.CCOC(=O)C1=CN2CCNCC2=N1
  10. 7-chloroimidazo[1,2-b]pyridazine

    CAS No.: 1383481-11-5
    Catalog No.: 137075
    Purity: 95%
    MF: C6H4ClN3
    MW: 153.572
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=NC=CN2N=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 25 total

  1. 1
  2. 2
  3. 3