•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Imidazopyrazines

Set Ascending Direction

   

Items 31 to 40 of 103 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 2-isopropylimidazo[1,2-a]pyrazin-8(7H)-one

    CAS No.: 850445-46-4
    Catalog No.: HKP0002
    Purity: 95%
    MF: C9H11N3O
    MW: 177.207
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C=1N=C2N(C=CNC2=O)C1
  2. 8-chloro-2-ethylimidazo[1,2-a]pyrazine

    CAS No.: 391954-17-9
    Catalog No.: HKP0003
    Purity: 95%
    MF: C8H8ClN3
    MW: 181.626
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=2N(C=CN1)C=C(N2)CC
  3. 8-chloro-2-cyclopropylimidazo[1,2-a]pyrazine

    CAS No.: 1334167-20-2
    Catalog No.: HKP0005
    Purity: 95%
    MF: C9H8ClN3
    MW: 193.637
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=2N(C=CN1)C=C(N2)C2CC2
  4. ethyl 8-chloroimidazo[1,2-a]pyrazine-2-carboxylate

    CAS No.: 1208083-32-2
    Catalog No.: HKP0006
    Purity: 95%
    MF: C9H8ClN3O2
    MW: 225.635
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=2N(C=CN1)C=C(N2)C(=O)OCC
  5. 3-bromo-8-chloro-2-methylimidazo[1,2-a]pyrazine

    CAS No.: 1124321-36-3
    Catalog No.: HKP0007
    Purity: 95%
    MF: C7H5BrClN3
    MW: 246.495
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(N=C2N1C=CN=C2Cl)C
  6. 3-bromo-8-chloro-2-ethylimidazo[1,2-a]pyrazine

    CAS No.: 1609367-65-8
    Catalog No.: HKP0008
    Purity: 95%
    MF: C8H7BrClN3
    MW: 260.522
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(N=C2N1C=CN=C2Cl)CC
  7. 3-bromo-8-chloro-2-isopropylimidazo[1,2-a]pyrazine

    CAS No.: 1334167-28-0
    Catalog No.: HKP0009
    Purity: 95%
    MF: C9H9BrClN3
    MW: 274.549
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(N=C2N1C=CN=C2Cl)C(C)C
  8. 3-bromo-8-chloro-2-cyclopropylimidazo[1,2-a]pyrazine

    CAS No.: 1334167-27-9
    Catalog No.: HKP0010
    Purity: 95%
    MF: C9H7BrClN3
    MW: 272.533
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(N=C2N1C=CN=C2Cl)C2CC2
  9. 3-bromo-8-chloro-2-(trifluoromethyl)imidazo[1,2-a]pyrazine

    CAS No.: 1334167-29-1
    Catalog No.: HKP0011
    Purity: 95%
    MF: C7H2BrClF3N3
    MW: 300.465
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(N=C2N1C=CN=C2Cl)C(F)(F)F
  10. ethyl 3-bromo-8-chloroimidazo[1,2-a]pyrazine-2-carboxylate

    CAS No.: 1334167-30-4
    Catalog No.: HKP0012
    Purity: 95%
    MF: C9H7BrClN3O2
    MW: 304.531
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(N=C2N1C=CN=C2Cl)C(=O)OCC
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 103 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6