•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Heterocyclics

Set Ascending Direction

   

Items 31 to 40 of 21296 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 3-phenyl-1H-pyrazol-4-amine

    CAS No.: 91857-86-2
    Catalog No.: 192882
    Purity: 95%
    MF: C9H9N3
    MW: 159.192
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C1=NNC=C1N
  2. ethyl 1,3-diphenyl-1H-pyrazole-5-carboxylate

    CAS No.: 94209-24-2
    Catalog No.: 192883
    Purity: 95%
    MF: C18H16N2O2
    MW: 292.338
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)N1N=C(C=C1C(=O)OCC)C1=CC=CC=C1
  3. 1,3-diphenyl-1H-pyrazole-5-carboxylic acid

    CAS No.: 964-42-1
    Catalog No.: 192885
    Purity: 95%
    MF: C16H12N2O2
    MW: 264.284
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)N1N=C(C=C1C(=O)O)C1=CC=CC=C1
  4. 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-3-carbonitrile

    CAS No.: 2158267-70-8
    Catalog No.: 192886
    Purity: 95%
    MF: C11H16BN3O2
    MW: 233.08
    Storage: 2-8 degree Celsius
    SMILES: CN1N=C(C(=C1)B1OC(C(O1)(C)C)(C)C)C#N
  5. 4-(1H-pyrazol-4-yl)morpholine

    CAS No.: 1638764-62-1
    Catalog No.: 192887
    Purity: 95%
    MF: C7H11N3O
    MW: 153.185
    Storage: 2-8 degree Celsius
    SMILES: N1N=CC(=C1)N1CCOCC1
  6. 3-(pyridin-2-yl)-1H-pyrazol-4-amine

    CAS No.: 896467-81-5
    Catalog No.: 192888
    Purity: 95%
    MF: C8H8N4
    MW: 160.18
    Storage: 2-8 degree Celsius
    SMILES: N1=C(C=CC=C1)C1=NNC=C1N
  7. 1H-pyrazolo[3,4-c]pyridine-7-carboxylic acid

    CAS No.: 1140239-98-0
    Catalog No.: 192889
    Purity: 95%
    MF: C7H5N3O2
    MW: 163.136
    Storage: 2-8 degree Celsius
    SMILES: N1N=CC=2C1=C(N=CC2)C(=O)O
  8. methyl 1H-pyrazolo[3,4-c]pyridine-7-carboxylate

    CAS No.: 1140240-00-1
    Catalog No.: 192890
    Purity: 95%
    MF: C8H7N3O2
    MW: 177.163
    Storage: 2-8 degree Celsius
    SMILES: N1N=CC=2C1=C(N=CC2)C(=O)OC
  9. 1H-pyrazolo[4,3-b]pyridine-6-carboxylic acid

    CAS No.: 1256807-59-6
    Catalog No.: 192891
    Purity: 95%
    MF: C7H5N3O2
    MW: 163.136
    Storage: 2-8 degree Celsius
    SMILES: N1N=CC2=NC=C(C=C21)C(=O)O
  10. methyl 6-bromo-5-methylpyrazolo[1,5-a]pyridine-3-carboxylate

    CAS No.: 1345121-19-8
    Catalog No.: 192892
    Purity: 95%
    MF: C10H9BrN2O2
    MW: 269.098
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=CC=2N(C1)N=CC2C(=O)OC)C
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 21296 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6