•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Heterocyclics

Set Ascending Direction

   

Items 41 to 50 of 21296 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. methyl 4-bromo-5-methylpyrazolo[1,5-a]pyridine-3-carboxylate

    CAS No.: 1345121-21-2
    Catalog No.: 192893
    Purity: 95%
    MF: C10H9BrN2O2
    MW: 269.098
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=2N(C=CC1C)N=CC2C(=O)OC
  2. 6-bromo-5-methylpyrazolo[1,5-a]pyridine

    CAS No.: 1345121-23-4
    Catalog No.: 192894
    Purity: 95%
    MF: C8H7BrN2
    MW: 211.062
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=CC=2N(C1)N=CC2)C
  3. 4-bromo-5-methylpyrazolo[1,5-a]pyridine

    CAS No.: 1345121-29-0
    Catalog No.: 192895
    Purity: 95%
    MF: C8H7BrN2
    MW: 211.062
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=2N(C=CC1C)N=CC2
  4. 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid

    CAS No.: 1352625-33-2
    Catalog No.: 192897
    Purity: 95%
    MF: C8H5FN2O2
    MW: 180.138
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=2N(C=CC1)N=CC2C(=O)O
  5. 4,6-dichloropyrazolo[1,5-a]pyridine

    CAS No.: 1427501-80-1
    Catalog No.: 192898
    Purity: 95%
    MF: C7H4Cl2N2
    MW: 187.029
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=2N(C=C(C1)Cl)N=CC2
  6. 3-(methoxycarbonyl)pyrazolo[1,5-a]pyridine-2-carboxylic acid

    CAS No.: 1476799-51-5
    Catalog No.: 192899
    Purity: 95%
    MF: C10H8N2O4
    MW: 220.184
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C=1C(=NN2C1C=CC=C2)C(=O)O
  7. methyl 2-((tert-butoxycarbonyl)amino)pyrazolo[1,5-a]pyridine-3-carboxylate

    CAS No.: 1476799-73-1
    Catalog No.: 192900
    Purity: 95%
    MF: C14H17N3O4
    MW: 291.307
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)NC1=NN2C(C=CC=C2)=C1C(=O)OC
  8. methyl 6-fluoropyrazolo[1,5-a]pyridine-3-carboxylate

    CAS No.: 1802489-63-9
    Catalog No.: 192901
    Purity: 95%
    MF: C9H7FN2O2
    MW: 194.165
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=CC=2N(C1)N=CC2C(=O)OC
  9. methyl 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylate

    CAS No.: 1802489-64-0
    Catalog No.: 192902
    Purity: 95%
    MF: C9H7FN2O2
    MW: 194.165
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=2N(C=CC1)N=CC2C(=O)OC
  10. (1H-pyrazolo[4,3-b]pyridin-6-yl)methanol

    CAS No.: 1934501-30-0
    Catalog No.: 192903
    Purity: 95%
    MF: C7H7N3O
    MW: 149.153
    Storage: 2-8 degree Celsius
    SMILES: N1N=CC2=NC=C(C=C21)CO
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 21296 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7