•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

GPCR & G Protein

Set Ascending Direction

   

Items 41 to 50 of 82 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. Ibutamoren Mesylate; MK-677

    CAS No.: 159752-10-0
    Catalog No.: 104910
    Purity: 95%
    MF: C28H40N4O8S2
    MW: 624.782
    Storage: 2-8 degree Celsius
    SMILES: CS(O)(=O)=O.CC(C)(N)C(=O)N[C@H](COCC1=CC=CC=C1)C(=O)N1CCC2(CN(C3=C2C=CC=C3)S(C)(=O)=O)CC1
  2. Cariprazine hydrochloride

    CAS No.: 1083076-69-0
    Catalog No.: 139010
    Purity: 95%
    MF: C21H33Cl3N4O
    MW: 463.881
    Storage: 2-8 degree Celsius
    SMILES: Cl.CN(C)C(=O)N[C@H]1CC[C@H](CCN2CCN(CC2)C2=C(Cl)C(Cl)=CC=C2)CC1
  3. SB408124

    CAS No.: 288150-92-5
    Catalog No.: 106212
    Purity: 95%
    MF: C19H18F2N4O
    MW: 356.376
    Storage: 2-8 degree Celsius
    SMILES: CN(C)C1=CC=C(NC(=O)NC2=CC(C)=NC3=C(F)C=C(F)C=C23)C=C1
  4. Reversine

    CAS No.: 656820-32-5
    Catalog No.: 106207
    Purity: 95%
    MF: C21H27N7O
    MW: 393.495
    Storage: 2-8 degree Celsius
    SMILES: C1CCC(CC1)NC1=C2NC=NC2=NC(NC2=CC=C(C=C2)N2CCOCC2)=N1
  5. Indacaterol

    CAS No.: 312753-06-3
    Catalog No.: 104909
    Purity: 95%
    MF: C24H28N2O3
    MW: 392.499
    Storage: 2-8 degree Celsius
    SMILES: CCC1=CC2=C(CC(C2)NC[C@H](O)C2=CC=C(O)C3=C2C=CC(=O)N3)C=C1CC
  6. RS 504393

    CAS No.: 300816-15-3
    Catalog No.: 104843
    Purity: 95%
    MF: C25H27N3O3
    MW: 417.509
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(CCN2CCC3(CC2)OC(=O)NC2=CC=C(C)C=C32)N=C(O1)C1=CC=CC=C1
  7. Cinacalcet HCl

    CAS No.: 364782-34-3
    Catalog No.: 104806
    Purity: 95%
    MF: C22H23ClF3N
    MW: 393.88
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].C[C@@H](NCCCC1=CC=CC(=C1)C(F)(F)F)C1=C2C=CC=CC2=CC=C1
  8. Ciproxifan maleate

    CAS No.: 184025-19-2
    Catalog No.: 104798
    Purity: 95%
    MF: C20H22N2O6
    MW: 386.404
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C/C(O)=O.O=C(C1CC1)C1=CC=C(OCCCC2=CN=CN2)C=C1
  9. Flesinoxan

    CAS No.: 98206-10-1
    Catalog No.: HKP0285
    Purity: 95%
    MF: C22H26FN3O4
    MW: 415.465
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C(=O)NCCN2CCN(CC2)C2=CC=CC=3O[C@@H](COC32)CO)C=C1
  10. Fosaprepitant dimeglumine salt

    CAS No.: 265121-04-8
    Catalog No.: 151798
    Purity: 95%
    MF: C37H56F7N6O16P
    MW: 1004.841
    Storage: 2-8 degree Celsius
    SMILES: CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.C[C@@H](O[C@H]1OCCN(CC2=NC(=O)N(N2)P(O)(O)=O)[C@H]1C1=CC=C(F)C=C1)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 82 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7