•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Furans

Set Ascending Direction

   

Items 61 to 70 of 353 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. ethyl 2-(furan-2-yl)acetate

    CAS No.: 4915-21-3
    Catalog No.: 133437
    Purity: 95%
    MF: C8H10O3
    MW: 154.165
    Storage: 2-8 degree Celsius
  2. 2-(furan-2-yl)acetohydrazide

    CAS No.: 98134-84-0
    Catalog No.: 133439
    Purity: 95%
    MF: C6H8N2O2
    MW: 140.142
    Storage: 2-8 degree Celsius
  3. (S)-1-(5-methylfuran-2-yl)propan-1-amine

    CAS No.: 473732-95-5
    Catalog No.: 134178
    Purity: 95%
    MF: C8H13NO
    MW: 139.198
    Storage: 2-8 degree Celsius
  4. 2-(furan-2-yl)-5-(methylsulfonyl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine

    CAS No.: 139181-28-5
    Catalog No.: 134599
    Purity: 95%
    MF: C9H8N6O3S
    MW: 280.269
    Storage: 2-8 degree Celsius
  5. furan-2-carbohydrazide

    CAS No.: 3326-71-4
    Catalog No.: 134613
    Purity: 95%
    MF: C5H6N2O2
    MW: 126.115
    Storage: 2-8 degree Celsius
  6. 3-(furan-2-yl)-1H-1,2,4-triazol-5-amine

    CAS No.: 3663-61-4
    Catalog No.: 134614
    Purity: 95%
    MF: C6H6N4O
    MW: 150.141
    Storage: 2-8 degree Celsius
  7. 2-(furan-2-yl)-5-(methylthio)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine

    CAS No.: 139181-27-4
    Catalog No.: 134615
    Purity: 95%
    MF: C9H8N6OS
    MW: 248.271
    Storage: 2-8 degree Celsius
    SMILES: CSC1=NC2=NC(=NN2C(N)=N1)C1=CC=CO1
  8. 5-(furan-2-yl)-1,2,4-oxadiazol-3-amine

    CAS No.: 23159-52-6
    Catalog No.: 134617
    Purity: 95%
    MF: C6H5N3O2
    MW: 151.125
    Storage: 2-8 degree Celsius
  9. 3-chloro-5-(furan-2-yl)-1,2,4-oxadiazole

    CAS No.: 1257878-64-0
    Catalog No.: 134618
    Purity: 95%
    MF: C6H3ClN2O2
    MW: 170.555
    Storage: 2-8 degree Celsius
  10. (S)-2-(tetrahydrofuran-2-yl)acetic acid

    CAS No.: 1240504-10-2
    Catalog No.: 134633
    Purity: 95%
    MF: C6H10O3
    MW: 130.143
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C[C@@H]1CCCO1
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 353 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9