•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Furans

Set Ascending Direction

   

Items 51 to 60 of 353 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. 2-bromo-3-furoic acid

    CAS No.: 197846-05-2
    Catalog No.: 126550
    Purity: 95%
    MF: C5H3BrO3
    MW: 190.98
    Storage: 2-8 degree Celsius
  2. 3-bromofuran-2-carboxylic acid

    CAS No.: 14903-90-3
    Catalog No.: 126551
    Purity: 95%
    MF: C5H3BrO3
    MW: 190.98
    Storage: 2-8 degree Celsius
  3. 5-iodo-2-furancarboxaldehyde

    CAS No.: 2689-65-8
    Catalog No.: 126552
    Purity: 95%
    MF: C5H3IO2
    MW: 221.981
    Storage: 2-8 degree Celsius
  4. 5-methylfuran-2-boronic acid

    CAS No.: 62306-79-0
    Catalog No.: 127911
    Purity: 95%
    MF: C5H7BO3
    MW: 125.92
    Storage: 2-8 degree Celsius
  5. 5-(4-nitrophenyl)furan-2-carboxylic acid

    CAS No.: 28123-73-1
    Catalog No.: 129048
    Purity: 95%
    MF: C11H7NO5
    MW: 233.179
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=C(O1)C1=CC=C(C=C1)[N+]([O-])=O
  6. 3-aminotetrahydrofuran-3-carboxylic acid

    CAS No.: 125218-55-5
    Catalog No.: 129245
    Purity: 95%
    MF: C5H9NO3
    MW: 131.131
    Storage: 2-8 degree Celsius
  7. methyl 5-bromo-2-methylfuran-3-carboxylate

    CAS No.: 345891-28-3
    Catalog No.: 129497
    Purity: 95%
    MF: C7H7BrO3
    MW: 219.034
    Storage: 2-8 degree Celsius
  8. tri(2-furyl)phosphine

    CAS No.: 5518-52-5
    Catalog No.: 131886
    Purity: 95%
    MF: C12H9O3P
    MW: 232.175
    Storage: 2-8 degree Celsius
  9. Furan-2-boronic acid

    CAS No.: 13331-23-2
    Catalog No.: 132623
    Purity: 95%
    MF: C4H5BO3
    MW: 111.893
    Storage: 2-8 degree Celsius
  10. 2-((oxiran-2-ylmethoxy)methyl)furan

    CAS No.: 5380-87-0
    Catalog No.: 132872
    Purity: 95%
    MF: C8H10O3
    MW: 154.165
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 51 to 60 of 353 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8