•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Fluorinated

Set Ascending Direction

   

Items 41 to 50 of 5778 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 2-bromo-5-chloro-4-fluorobenzoic acid

    CAS No.: 1519109-81-9
    Catalog No.: 193908
    Purity: 95%
    MF: C7H3BrClFO2
    MW: 253.454
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C(=O)O)C=C(C(=C1)F)Cl
  2. 2-bromo-5-iodo-1,3-bis(trifluoromethyl)benzene

    CAS No.: 2383655-21-6
    Catalog No.: 193911
    Purity: 95%
    MF: C8H2BrF6I
    MW: 418.9
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C(C=C1C(F)(F)F)I)C(F)(F)F
  3. 2-chloro-3,6-difluorobenzoic acid

    CAS No.: 287172-74-1
    Catalog No.: 193917
    Purity: 95%
    MF: C7H3ClF2O2
    MW: 192.548
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C(=O)O)C(=CC=C1F)F
  4. 2-chloro-4-(trifluoromethoxy)benzyl alcohol

    CAS No.: 1261822-74-5
    Catalog No.: 193921
    Purity: 95%
    MF: C8H6ClF3O2
    MW: 226.581
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(CO)C=CC(=C1)OC(F)(F)F
  5. 2-chloro-4-(trifluoromethoxy)nitrobenzene

    CAS No.: 85578-47-8
    Catalog No.: 193922
    Purity: 95%
    MF: C7H3ClF3NO3
    MW: 241.552
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=CC(=C1)OC(F)(F)F)[N+](=O)[O-]
  6. 2-chloro-5-(trifluoromethoxy)benzyl alcohol

    CAS No.: 1261483-31-1
    Catalog No.: 193925
    Purity: 95%
    MF: C8H6ClF3O2
    MW: 226.581
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(CO)C=C(C=C1)OC(F)(F)F
  7. 2-fluoro-1,3-dimethyl-5-nitrobenzene

    CAS No.: 1736-85-2
    Catalog No.: 193929
    Purity: 95%
    MF: C8H8FNO2
    MW: 169.155
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C=C(C=C1C)[N+](=O)[O-])C
  8. 2-fluoro-3-hydroxybenzonitrile

    CAS No.: 1000339-24-1
    Catalog No.: 193930
    Purity: 95%
    MF: C7H4FNO
    MW: 137.113
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C#N)C=CC=C1O
  9. 1-(2-fluoro-4-(trifluoromethyl)phenyl)ethan-1-one

    CAS No.: 122023-29-4
    Catalog No.: 193931
    Purity: 95%
    MF: C9H6F4O
    MW: 206.138
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C=CC(=C1)C(F)(F)F)C(C)=O
  10. 2-fluoro-5-nitrobenzoyl chloride

    CAS No.: 709-46-6
    Catalog No.: 193932
    Purity: 95%
    MF: C7H3ClFNO3
    MW: 203.556
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C(=O)Cl)C=C(C=C1)[N+](=O)[O-]
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 5778 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7