•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Fluorinated

Set Descending Direction

   

Items 11 to 20 of 5778 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1-bromo-2-chloro-4-fluoro-5-methoxybenzene

    CAS No.: 1823372-35-5
    Catalog No.: 193836
    Purity: 95%
    MF: C7H5BrClFO
    MW: 239.471
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C(C(=C1)OC)F)Cl
  2. 1-bromo-3-fluoro-5-(trifluoromethoxy)benzene

    CAS No.: 1129541-09-8
    Catalog No.: 193839
    Purity: 95%
    MF: C7H3BrF4O
    MW: 258.996
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC(=CC(=C1)OC(F)(F)F)F
  3. 2,3,4-trifluoro-5-nitrobenzoic acid

    CAS No.: 197520-71-1
    Catalog No.: 193846
    Purity: 95%
    MF: C7H2F3NO4
    MW: 221.09
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C(=O)O)C=C(C(=C1F)F)[N+](=O)[O-]
  4. 2,3,5-trifluorobenzoic acid

    CAS No.: 654-87-5
    Catalog No.: 193850
    Purity: 95%
    MF: C7H3F3O2
    MW: 176.093
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C(=O)O)C=C(C=C1F)F
  5. 2,3,6-trifluoroaniline

    CAS No.: 67815-56-9
    Catalog No.: 193852
    Purity: 95%
    MF: C6H4F3N
    MW: 147.099
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(N)C(=CC=C1F)F
  6. 2,3-difluoro-5-methylbenzonitrile

    CAS No.: 1003712-18-2
    Catalog No.: 193858
    Purity: 95%
    MF: C8H5F2N
    MW: 153.131
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C#N)C=C(C=C1F)C
  7. 2,3-dimethyl-4-bromofluorobenzene

    CAS No.: 52548-00-2
    Catalog No.: 193860
    Purity: 95%
    MF: C8H8BrF
    MW: 203.054
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C=CC(=C1C)Br)F
  8. 2,4,5-trifluoro-3-methoxybenzoic acid

    CAS No.: 112811-65-1
    Catalog No.: 193861
    Purity: 95%
    MF: C8H5F3O3
    MW: 206.119
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C(=O)O)C=C(C(=C1OC)F)F
  9. 2,4,6-tribromo-3,5-difluorobenzonitrile

    CAS No.: 943528-40-3
    Catalog No.: 193863
    Purity: 95%
    MF: C7Br3F2N
    MW: 375.792
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C#N)C(=C(C(=C1F)Br)F)Br
  10. 2,4-dichloro-3-fluorobenzaldehyde

    CAS No.: 1785621-05-7
    Catalog No.: 193866
    Purity: 95%
    MF: C7H3Cl2FO
    MW: 193.004
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=O)C=CC(=C1F)Cl
Loading ...Load More ...
Set Descending Direction

   

Items 11 to 20 of 5778 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5