•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Fluorinated

Set Ascending Direction

   

Items 21 to 30 of 5778 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2,4-difluoro-5-nitrophenol

    CAS No.: 113512-57-5
    Catalog No.: 193869
    Purity: 95%
    MF: C6H3F2NO3
    MW: 175.09
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C=C(C(=C1)F)[N+](=O)[O-])O
  2. 2,5-dichloro-4-fluorobenzonitrile

    CAS No.: 1804886-09-6
    Catalog No.: 193873
    Purity: 95%
    MF: C7H2Cl2FN
    MW: 190.004
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C#N)C=C(C(=C1)F)Cl
  3. 2,5-dichloro-4-fluorobenzotrifluoride

    CAS No.: 89634-77-5
    Catalog No.: 193874
    Purity: 95%
    MF: C7H2Cl2F4
    MW: 232.991
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C(=C1)F)Cl)C(F)(F)F
  4. 2,5-difluoro-4-(trifluoromethyl)benzonitrile

    CAS No.: 261945-24-8
    Catalog No.: 193875
    Purity: 95%
    MF: C8H2F5N
    MW: 207.101
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C#N)C=C(C(=C1)C(F)(F)F)F
  5. 2,6-dibromo-3,5-difluoro-1-iodobenzene

    CAS No.: 1805471-65-1
    Catalog No.: 193877
    Purity: 95%
    MF: C6HBr2F2I
    MW: 397.782
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C(=C(C=C1F)F)Br)I
  6. 2,6-dibromofluorobenzene

    CAS No.: 1435-54-7
    Catalog No.: 193878
    Purity: 95%
    MF: C6H3Br2F
    MW: 253.896
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C(=CC=C1)Br)F
  7. 2,6-dichloro-4-fluorobenzonitrile

    CAS No.: 1473423-59-4
    Catalog No.: 193879
    Purity: 95%
    MF: C7H2Cl2FN
    MW: 190.004
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C#N)C(=CC(=C1)F)Cl
  8. 2,6-difluoro-3-chlorobromobenzene

    CAS No.: 229180-34-1
    Catalog No.: 193882
    Purity: 95%
    MF: C6H2BrClF2
    MW: 227.435
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C(=CC=C1Cl)F)Br
  9. 2-amino-3-bromo-4-fluorobenzonitrile

    CAS No.: 1093951-76-8
    Catalog No.: 193883
    Purity: 95%
    MF: C7H4BrFN2
    MW: 215.025
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C#N)C=CC(=C1Br)F
  10. 2-amino-3-fluorobenzotrifluoride

    CAS No.: 144851-61-6
    Catalog No.: 193884
    Purity: 95%
    MF: C7H5F4N
    MW: 179.116
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C=CC=C1F)C(F)(F)F
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 5778 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5