•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Fluorinated

Set Ascending Direction

   

Items 1 to 10 of 5778 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 7-bromo-6-fluoro-1-methyl-1H-indazole

    CAS No.: 1528865-93-1
    Catalog No.: 193472
    Purity: 95%
    MF: C8H6BrFN2
    MW: 229.052
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=CC=C2C=NN(C12)C)F
  2. methyl 4-bromo-5-fluoro-2-nitrobenzoate

    CAS No.: 1220886-29-2
    Catalog No.: 193521
    Purity: 95%
    MF: C8H5BrFNO4
    MW: 278.033
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC(=C(C(=O)OC)C=C1F)[N+](=O)[O-]
  3. 2,4-difluoro-6-iodophenol

    CAS No.: 551002-42-7
    Catalog No.: 193799
    Purity: 95%
    MF: C6H3F2IO
    MW: 255.989
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C(=CC(=C1)F)I)O
  4. (3,3-difluorocyclopentyl)methanamine

    CAS No.: 1260790-17-7
    Catalog No.: 193809
    Purity: 95%
    MF: C6H11F2N
    MW: 135.157
    Storage: 2-8 degree Celsius
    SMILES: FC1(CC(CC1)CN)F
  5. methyl 7-fluoro-2-oxoindoline-4-carboxylate

    CAS No.: 1260776-33-7
    Catalog No.: 193819
    Purity: 95%
    MF: C10H8FNO3
    MW: 209.176
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=2CC(NC12)=O)C(=O)OC
  6. 1-(3,4-difluorophenyl)ethanol

    CAS No.: 321318-21-2
    Catalog No.: 193822
    Purity: 95%
    MF: C8H8F2O
    MW: 158.147
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=C(C=CC1F)C(C)O
  7. 1,3-dimethoxy-5-fluoro-2-nitrobenzene

    CAS No.: 1806452-66-3
    Catalog No.: 193827
    Purity: 95%
    MF: C8H8FNO4
    MW: 201.153
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C(=CC(=C1)F)OC)[N+](=O)[O-]
  8. 1,5-dibromo-2,3,4-trifluorobenzene

    CAS No.: 17299-95-5
    Catalog No.: 193831
    Purity: 95%
    MF: C6HBr2F3
    MW: 289.876
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C(=C(C(=C1)Br)F)F)F
  9. 1-bromo-2,3-dichloro-5-fluorobenzene

    CAS No.: 1000577-58-1
    Catalog No.: 193834
    Purity: 95%
    MF: C6H2BrCl2F
    MW: 243.89
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C(=CC(=C1)F)Cl)Cl
  10. 2-bromo-1-chloro-3,5-difluorobenzene

    CAS No.: 1020198-58-6
    Catalog No.: 193835
    Purity: 95%
    MF: C6H2BrClF2
    MW: 227.435
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C(C=C1F)F)Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 5778 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5