•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Epigenetics

Set Ascending Direction

   

Items 31 to 40 of 53 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. KG-501 (2-naphthol-AS-E-phosphate)

    CAS No.: 18228-17-6
    Catalog No.: 193713
    Purity: 95%
    MF: C17H13ClNO5P
    MW: 377.72
    Storage: 2-8 degree Celsius
    SMILES: P(=O)(OC1=CC2=CC=CC=C2C=C1C(NC1=CC=C(C=C1)Cl)=O)(O)O
  2. CF53

    CAS No.: 1808160-52-2
    Catalog No.: TQR1201
    Purity: 95%
    MF: C24H25N7O2
    MW: 443.511
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C1=NN(C(=C1)NC1=NC(=NC=2NC3=CC(=C(C=C3C21)OC)C=2C(=NOC2C)C)C)C
  3. FM-381

    CAS No.: 2226521-65-7
    Catalog No.: TQR1213
    Purity: 95%
    MF: C24H24N6O2
    MW: 428.496
    Storage: 2-8 degree Celsius
    SMILES: C(#N)/C(/C(=O)N(C)C)=C\C=1OC(=CC1)C1=NC=2C(=C3C(=NC2)NC=C3)N1C1CCCCC1
  4. UNC1999

    CAS No.: 1431612-23-5
    Catalog No.: 111910
    Purity: 95%
    MF: C33H43N7O2
    MW: 569.754
    Storage: 2-8 degree Celsius
    SMILES: CCCC1=C(CNC(=O)C2=CC(=CC3=C2C=NN3C(C)C)C2=CC=C(N=C2)N2CCN(CC2)C(C)C)C(=O)NC(C)=C1
  5. UNC0379

    CAS No.: 1620401-82-2
    Catalog No.: 134378
    Purity: 95%
    MF: C23H35N5O2
    MW: 413.566
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(OC)C=C2C(NCCCCCN3CCCC3)=NC(=NC2=C1)N1CCCC1
  6. Fisetin

    CAS No.: 528-48-3
    Catalog No.: 151622
    Purity: 95%
    MF: C15H10O6
    MW: 286.239
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC=C2C(OC(=C(O)C2=O)C2=CC(O)=C(O)C=C2)=C1
  7. Entacapone

    CAS No.: 130929-57-6
    Catalog No.: 151825
    Purity: 95%
    MF: C14H15N3O5
    MW: 305.29
    Storage: 2-8 degree Celsius
    SMILES: CCN(CC)C(=O)C(=C\C1=CC(O)=C(O)C(=C1)[N+]([O-])=O)\C#N
  8. Anacardic Acid

    CAS No.: 16611-84-0
    Catalog No.: 152033
    Purity: 95%
    MF: C22H36O3
    MW: 348.527
    Storage: 2-8 degree Celsius
    SMILES: CCCCCCCCCCCCCCCC1=CC=CC(O)=C1C(O)=O
  9. Upadacitinib; ABT-494

    CAS No.: 1310726-60-3
    Catalog No.: 183282
    Purity: 95%
    MF: C17H19F3N6O
    MW: 380.374
    Storage: 2-8 degree Celsius
    SMILES: CC[C@@H]1CN(C[C@@H]1C1=CN=C2C=NC3=C(C=CN3)N12)C(=O)NCC(F)(F)F
  10. MRTX-1719

    CAS No.: 2630904-45-7
    Catalog No.: WLZ3536
    Purity: 95%
    MF: C23H18ClFN6O2
    MW: 464.888
    Storage: 2-8 degree Celsius
    SMILES: O=C1NN=C(CN)C2=C1C=CC(C3=C(C4=C(C#N)C(OC5CC5)=CC(Cl)=C4F)N(C)N=C3)=C2
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 53 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6