•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

EGFR

Set Ascending Direction

   

Items 21 to 26 of 26 total

  1. 1
  2. 2
  3. 3
  1. Tucatinib hemiethanolate

    CAS No.: 1429755-56-5
    Catalog No.: WLZ3767
    Purity: 95%
    MF: C28H30N8O3
    MW: 526.601
    Storage: 2-8 degree Celsius
    SMILES: C(C)O.CC1(N=C(OC1)NC=1C=C2C(=NC=NC2=CC1)NC1=CC(=C(C=C1)OC1=CC=2N(C=C1)N=CN2)C)C
  2. Tesevatinib

    CAS No.: 781613-23-8
    Catalog No.: 169474
    Purity: 95%
    MF: C24H25Cl2FN4O2
    MW: 491.394
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12C[C@H](COC3=CC4=NC=NC(NC5=CC=C(Cl)C(Cl)=C5F)=C4C=C3OC)C[C@]1([H])CN(C)C2
  3. EAI045

    CAS No.: 1942114-09-1
    Catalog No.: 158440
    Purity: 95%
    MF: C19H14FN3O3S
    MW: 383.404
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(C=C(F)C=C1)C(N1CC2=C(C=CC=C2)C1=O)C(=O)NC1=NC=CS1
  4. Butein

    CAS No.: 487-52-5
    Catalog No.: 152152
    Purity: 95%
    MF: C15H12O5
    MW: 272.256
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC(O)=C(C=C1)C(=O)\C=C\C1=CC(O)=C(O)C=C1
  5. OSI-420 hydrochloride

    CAS No.: 183320-51-6
    Catalog No.: 151601
    Purity: 95%
    MF: C21H22ClN3O4
    MW: 415.877
    Storage: 2-8 degree Celsius
    SMILES: Cl.COCCOC1=C(OCCO)C=C2C(NC3=CC(=CC=C3)C#C)=NC=NC2=C1
  6. Poziotinib; HM781-36B

    CAS No.: 1092364-38-9
    Catalog No.: 141917
    Purity: 95%
    MF: C23H21Cl2FN4O3
    MW: 491.35
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(OC2CCN(CC2)C(=O)C=C)C=C2C(NC3=C(F)C(Cl)=C(Cl)C=C3)=NC=NC2=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 26 of 26 total

  1. 1
  2. 2
  3. 3