•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Difluoromethyls

Set Ascending Direction

   

Items 1 to 10 of 485 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. ethyl 2-(difluoromethyl)pyrimidine-5-carboxylate

    CAS No.: 1708944-99-3
    Catalog No.: HKP0095
    Purity: 95%
    MF: C8H8F2N2O2
    MW: 202.16
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=NC=C(C=N1)C(=O)OCC)F
  2. 2-(difluoromethyl)pyrimidine-5-carboxylic acid

    CAS No.: 1260902-00-8
    Catalog No.: HKP0096
    Purity: 95%
    MF: C6H4F2N2O2
    MW: 174.106
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=NC=C(C=N1)C(=O)O)F
  3. 2-chloro-5-(difluoromethyl)-3,6-dimethylpyrazine

    CAS No.: 2136637-59-5
    Catalog No.: HKP0097
    Purity: 95%
    MF: C7H7ClF2N2
    MW: 192.596
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=C(N=C1C)C(F)F)C
  4. 1-(difluoromethyl)-3-methylisoquinoline

    CAS No.: 2136637-60-8
    Catalog No.: HKP0098
    Purity: 95%
    MF: C11H9F2N
    MW: 193.196
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=NC(=CC2=CC=CC=C12)C)F
  5. 2-chloro-3-(difluoromethyl)quinoxaline

    CAS No.: 2136637-61-9
    Catalog No.: HKP0099
    Purity: 95%
    MF: C9H5ClF2N2
    MW: 214.602
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC2=CC=CC=C2N=C1C(F)F
  6. 2-chloro-6-(difluoromethyl)nicotinonitrile

    CAS No.: 1662687-58-2
    Catalog No.: TQ0053
    Purity: 95%
    MF: C7H3ClF2N2
    MW: 188.564
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C#N)C=CC(=N1)C(F)F
  7. 4-(difluoromethyl)pyrimidin-2-amine

    CAS No.: 1780891-13-5
    Catalog No.: TQ0102
    Purity: 95%
    MF: C5H5F2N3
    MW: 145.112
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=NC(=NC=C1)N)F
  8. 5-bromo-4-(difluoromethyl)pyrimidin-2-amine

    CAS No.: 1785472-42-5
    Catalog No.: TQ0103
    Purity: 95%
    MF: C5H4BrF2N3
    MW: 224.008
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=NC(=NC1)N)C(F)F
  9. 2-bromo-3-(difluoromethyl)-1,4-difluorobenzene

    CAS No.: 1672663-79-4
    Catalog No.: TQR0355
    Purity: 95%
    MF: C7H3BrF4
    MW: 242.997
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=CC(=C1C(F)F)F)F
  10. 2-(difluoromethyl)-3,6-difluorobenzonitrile

    CAS No.: 1672663-80-7
    Catalog No.: TQR0356
    Purity: 95%
    MF: C8H3F4N
    MW: 189.111
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=C(C#N)C(=CC=C1F)F)F
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 485 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5