•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cyclopropanes

Set Ascending Direction

   

Items 41 to 50 of 236 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. (S)-2,2-difluorocyclopropanecarboxylic acid

    CAS No.: 1883301-82-3
    Catalog No.: TQP0899
    Purity: 95%
    MF: C4H4F2O2
    MW: 122.07
    Storage: 2-8 degree Celsius
    SMILES: FC1([C@@H](C1)C(=O)O)F
  2. (2S,3S)-3-amino-N-cyclopropyl-2-hydroxyheptanamide hydrochloride

    CAS No.: 1185738-98-0
    Catalog No.: TQR0877
    Purity: 95%
    MF: C10H21ClN2O2
    MW: 236.743
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@H]([C@@H](C(=O)NC1CC1)O)CCCC
  3. 1-((tert-butoxycarbonyl)amino)-2,2-difluorocyclopropanecarboxylic acid

    CAS No.: 796882-45-6
    Catalog No.: TQU0023
    Purity: 95%
    MF: C9H13F2NO4
    MW: 237.202
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)NC1(C(C1)(F)F)C(=O)O
  4. (2,2-difluoro-1-methylcyclopropyl)methanol

    CAS No.: 128230-72-8
    Catalog No.: TQU0025
    Purity: 95%
    MF: C5H8F2O
    MW: 122.114
    Storage: 2-8 degree Celsius
    SMILES: FC1(C(C1)(C)CO)F
  5. (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate

    CAS No.: 219859-71-9
    Catalog No.: TQU0026
    Purity: 95%
    MF: C11H12F2O3S
    MW: 262.277
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=C1)S(=O)(=O)OCC1C(C1)(F)F
  6. (2,2-difluorocyclopropane-1,1-diyl)dimethanol

    CAS No.: 228580-15-2
    Catalog No.: TQU0027
    Purity: 95%
    MF: C5H8F2O2
    MW: 138.113
    Storage: 2-8 degree Celsius
    SMILES: FC1(C(C1)(CO)CO)F
  7. (2,2-difluoro-1-phenylcyclopropyl)methanol

    CAS No.: 156020-86-9
    Catalog No.: TQU0028
    Purity: 95%
    MF: C10H10F2O
    MW: 184.185
    Storage: 2-8 degree Celsius
    SMILES: FC1(C(C1)(C1=CC=CC=C1)CO)F
  8. 2-(bromomethyl)-1,1-difluorocyclopropane

    CAS No.: 77613-65-1
    Catalog No.: TQU0029
    Purity: 95%
    MF: C4H5BrF2
    MW: 170.984
    Storage: 2-8 degree Celsius
    SMILES: BrCC1C(C1)(F)F
  9. (1R,2S)-2-(3,4-difluorophenyl)cyclopropanamine (R)-2-hydroxy-2-phenylacetate

    CAS No.: 376608-71-8
    Catalog No.: 101861
    Purity: 95%
    MF: C17H17F2NO3
    MW: 321.323
    Storage: 2-8 degree Celsius
    SMILES: O[C@@H](C(O)=O)C1=CC=CC=C1.N[C@@H]1C[C@H]1C1=CC=C(F)C(F)=C1
  10. (1-aminocyclopropyl)methanol hydrochloride

    CAS No.: 115652-52-3
    Catalog No.: 104452
    Purity: 95%
    MF: C4H10ClNO
    MW: 123.583
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].NC1(CO)CC1
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 236 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7