•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cyclopropanes

Set Ascending Direction

   

Items 31 to 40 of 236 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 4-(1-((tert-butoxycarbonyl)amino)cyclopropyl)benzoic acid

    CAS No.: 1256336-73-8
    Catalog No.: 193301
    Purity: 95%
    MF: C15H19NO4
    MW: 277.32
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)NC1(CC1)C1=CC=C(C(=O)O)C=C1
  2. 2-(3-bromophenyl)cyclopropanamine hydrochloride

    CAS No.: 1305710-84-2
    Catalog No.: 193302
    Purity: 95%
    MF: C9H11BrClN
    MW: 248.551
    Storage: 2-8 degree Celsius
    SMILES: Cl.BrC=1C=C(C=CC1)C1C(C1)N
  3. tert-butyl 2-(3-bromophenyl)cyclopropylcarbamate

    CAS No.: 2061925-65-1
    Catalog No.: 193303
    Purity: 95%
    MF: C14H18BrNO2
    MW: 312.207
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C=CC1)C1C(C1)NC(OC(C)(C)C)=O
  4. ethyl 2-(4-(dimethylamino)phenyl)cyclopropanecarboxylate

    CAS No.: 1071129-26-4
    Catalog No.: 193306
    Purity: 95%
    MF: C14H19NO2
    MW: 233.311
    Storage: 2-8 degree Celsius
    SMILES: CN(C1=CC=C(C=C1)C1C(C1)C(=O)OCC)C
  5. 2-(tert-butoxycarbonyl)cyclopropanecarboxylic acid

    CAS No.: 1083181-22-9
    Catalog No.: 193307
    Purity: 95%
    MF: C9H14O4
    MW: 186.207
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)C1C(C1)C(=O)O
  6. ethyl 2-ethylcyclopropanecarboxylate

    CAS No.: 115188-22-2
    Catalog No.: 193309
    Purity: 95%
    MF: C8H14O2
    MW: 142.198
    Storage: 2-8 degree Celsius
    SMILES: C(C)C1C(C1)C(=O)OCC
  7. 2-(4-(dimethylamino)phenyl)cyclopropanecarboxylic acid

    CAS No.: 1157641-86-5
    Catalog No.: 193310
    Purity: 95%
    MF: C12H15NO2
    MW: 205.257
    Storage: 2-8 degree Celsius
    SMILES: CN(C1=CC=C(C=C1)C1C(C1)C(=O)O)C
  8. 2-(2,3-dichlorophenyl)cyclopropanecarboxylic acid

    CAS No.: 1157698-55-9
    Catalog No.: 193311
    Purity: 95%
    MF: C10H8Cl2O2
    MW: 231.078
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=CC=C1Cl)C1C(C1)C(=O)O
  9. 4-cyclopropylthiazole

    CAS No.: 433217-34-6
    Catalog No.: 193313
    Purity: 95%
    MF: C6H7NS
    MW: 125.196
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C=1N=CSC1
  10. 2-(pent-4-yn-1-yl)cyclopropanol

    CAS No.: 1350619-77-0
    Catalog No.: TQP0851
    Purity: 95%
    MF: C8H12O
    MW: 124.183
    Storage: 2-8 degree Celsius
    SMILES: C(CCC#C)C1C(C1)O
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 236 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6