•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cyclopropanes

Set Ascending Direction

   

Items 21 to 30 of 236 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-Cyclopropyl-2-propenoic acid ethyl ester

    CAS No.: 5808-99-1
    Catalog No.: 193290
    Purity: 95%
    MF: C8H12O2
    MW: 140.182
    Storage: 2-8 degree Celsius
    SMILES: C(C)OC(C=CC1CC1)=O
  2. (2-phenylcyclopropyl)methanol

    CAS No.: 61826-40-2
    Catalog No.: 193291
    Purity: 95%
    MF: C10H12O
    MW: 148.205
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C1C(C1)CO
  3. 2-ethylcyclopropane-1-carboxylic acid

    CAS No.: 68850-10-2
    Catalog No.: 193292
    Purity: 95%
    MF: C6H10O2
    MW: 114.144
    Storage: 2-8 degree Celsius
    SMILES: C(C)C1C(C1)C(=O)O
  4. (1S,2S)-ethyl 2-((benzyloxy)methyl)cyclopropanecarboxylate

    CAS No.: 692778-41-9
    Catalog No.: 193293
    Purity: 95%
    MF: C14H18O3
    MW: 234.295
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC[C@@H]1[C@H](C1)C(=O)OCC
  5. 2-(3-(trifluoromethyl)phenyl)cyclopropanecarboxylic acid

    CAS No.: 721-22-2
    Catalog No.: 193294
    Purity: 95%
    MF: C11H9F3O2
    MW: 230.185
    Storage: 2-8 degree Celsius
    SMILES: FC(C=1C=C(C=CC1)C1C(C1)C(=O)O)(F)F
  6. 2-(1-(methylsulfonyloxy)cyclopropyl)acetic acid

    CAS No.: 832142-14-0
    Catalog No.: 193295
    Purity: 95%
    MF: C6H10O5S
    MW: 194.208
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)OC1(CC1)CC(=O)O
  7. 1-(2,2-diethoxyethyl)cyclopropanol

    CAS No.: 832142-17-3
    Catalog No.: 193296
    Purity: 95%
    MF: C9H18O3
    MW: 174.24
    Storage: 2-8 degree Celsius
    SMILES: C(C)OC(CC1(CC1)O)OCC
  8. trans-2-cyclopropylcyclopropanecarboxylic acid

    CAS No.: 89851-39-8
    Catalog No.: 193297
    Purity: 95%
    MF: C7H10O2
    MW: 126.155
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)[C@H]1[C@@H](C1)C(=O)O
  9. trans-2-(3-bromo-phenyl)-cyclopropanecarboxylic acid

    CAS No.: 34919-34-1
    Catalog No.: 193298
    Purity: 95%
    MF: C10H9BrO2
    MW: 241.084
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C=CC1)[C@H]1[C@@H](C1)C(=O)O
  10. 1-(tert-butoxycarbonylamino-methyl)-cyclopropanecarboxylic acid ethyl ester

    CAS No.: 942830-53-7
    Catalog No.: 193300
    Purity: 95%
    MF: C12H21NO4
    MW: 243.303
    Storage: 2-8 degree Celsius
    SMILES: C(C)OC(=O)C1(CC1)CNC(=O)OC(C)(C)C
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 236 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5