•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cyclopentanes

Set Ascending Direction

   

Items 31 to 40 of 198 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. trans-2-methylcyclopentanol

    CAS No.: 25144-04-1
    Catalog No.: 192704
    Purity: 95%
    MF: C6H12O
    MW: 100.161
    Storage: 2-8 degree Celsius
    SMILES: C[C@H]1[C@@H](CCC1)O
  2. cis-2-methylcyclopentanol

    CAS No.: 25144-05-2
    Catalog No.: 192705
    Purity: 95%
    MF: C6H12O
    MW: 100.161
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H]1[C@@H](CCC1)O
  3. Cis-tert-butyl-2-carbamoylcyclopentylcarbamate

    CAS No.: 494209-36-8
    Catalog No.: 192707
    Purity: 95%
    MF: C11H20N2O3
    MW: 228.292
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(N[C@H]1[C@H](CCC1)C(N)=O)=O
  4. rel-(1R,2S)-2-Aminocyclopentanecarboxamide hydrochloride

    CAS No.: 494209-39-1
    Catalog No.: 192708
    Purity: 95%
    MF: C6H13ClN2O
    MW: 164.636
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@@H]1[C@@H](CCC1)C(=O)N
  5. ethyl 2-Hydroxycyclopentanecarboxylate

    CAS No.: 54972-10-0
    Catalog No.: 192709
    Purity: 95%
    MF: C8H14O3
    MW: 158.197
    Storage: 2-8 degree Celsius
    SMILES: OC1C(CCC1)C(=O)OCC
  6. tert-butyl 1-(aminomethyl)cyclopentylcarbamate

    CAS No.: 889949-09-1
    Catalog No.: 192710
    Purity: 95%
    MF: C11H22N2O2
    MW: 214.309
    Storage: 2-8 degree Celsius
    SMILES: NCC1(CCCC1)NC(OC(C)(C)C)=O
  7. tert-butyl 1-cyanocyclopentylcarbamate

    CAS No.: 912770-99-1
    Catalog No.: 192711
    Purity: 95%
    MF: C11H18N2O2
    MW: 210.277
    Storage: 2-8 degree Celsius
    SMILES: C(#N)C1(CCCC1)NC(OC(C)(C)C)=O
  8. 3-((tert-butoxycarbonyl)amino)cyclopentanecarboxylicacid

    CAS No.: 855863-93-3
    Catalog No.: 198972
    Purity: 95%
    MF: C11H19NO4
    MW: 229.276
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)NC1CC(CC1)C(=O)O
  9. ((1S,4R)-4-aminocyclopent-2-en-1-yl)methanol (2S,3S)-2,3-dihydroxysuccinate

    CAS No.: 229177-52-0
    Catalog No.: 199363
    Purity: 95%
    MF: C10H17NO7
    MW: 263.246
    Storage: 2-8 degree Celsius
    SMILES: O[C@H](C(=O)O)[C@@H](C(=O)O)O.N[C@H]1C=C[C@H](C1)CO
  10. ((1S,4R)-4-aminocyclopent-2-en-1-yl)methanol hydrochloride

    CAS No.: 168960-19-8
    Catalog No.: 199364
    Purity: 95%
    MF: C6H12ClNO
    MW: 149.621
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@H]1C=C[C@H](C1)CO
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 198 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6