•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cyclopentanes

Set Ascending Direction

   

Items 1 to 10 of 198 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (1R,2S)-rel-2-Aminocyclopentanecarboxylic acid hydrochloride

    CAS No.: 18414-30-7
    Catalog No.: 193258
    Purity: 95%
    MF: C6H12ClNO2
    MW: 165.62
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@@H]1[C@@H](CCC1)C(=O)O
  2. (3,3-difluorocyclopentyl)methanamine

    CAS No.: 1260790-17-7
    Catalog No.: 193809
    Purity: 95%
    MF: C6H11F2N
    MW: 135.157
    Storage: 2-8 degree Celsius
    SMILES: FC1(CC(CC1)CN)F
  3. 3-(nitromethyl)cyclopentanone

    CAS No.: 81266-47-9
    Catalog No.: 193820
    Purity: 95%
    MF: C6H9NO3
    MW: 143.142
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])CC1CC(CC1)=O
  4. ethyl 1-aminocyclopent-3-enecarboxylate

    CAS No.: 199532-88-2
    Catalog No.: TQ0162
    Purity: 95%
    MF: C8H13NO2
    MW: 155.197
    Storage: 2-8 degree Celsius
    SMILES: NC1(CC=CC1)C(=O)OCC
  5. 1-(4-hydroxy-5-methoxy-2-nitrophenyl)cyclopentanecarbonitrile

    CAS No.: 2380022-54-6
    Catalog No.: TQR1150
    Purity: 95%
    MF: C13H14N2O4
    MW: 262.265
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC(=C(C=C1OC)C1(CCCC1)C#N)[N+](=O)[O-]
  6. 1-(4-(3-chloropropoxy)-5-methoxy-2-nitrophenyl)cyclopentanecarbonitrile

    CAS No.: 2380021-62-3
    Catalog No.: TQR1151
    Purity: 95%
    MF: C16H19ClN2O4
    MW: 338.791
    Storage: 2-8 degree Celsius
    SMILES: ClCCCOC1=CC(=C(C=C1OC)C1(CCCC1)C#N)[N+](=O)[O-]
  7. 1-(5-(cyclopropylmethoxy)-4-hydroxy-2-nitrophenyl)cyclopentanecarbonitrile

    CAS No.: 2410841-80-2
    Catalog No.: TQR1152
    Purity: 95%
    MF: C16H18N2O4
    MW: 302.33
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)COC=1C(=CC(=C(C1)C1(CCCC1)C#N)[N+](=O)[O-])O
  8. 1-(difluoromethyl)cyclopentanamine hydrochloride

    CAS No.: 1803583-82-5
    Catalog No.: TQU0056
    Purity: 95%
    MF: C6H12ClF2N
    MW: 171.618
    Storage: 2-8 degree Celsius
    SMILES: Cl.FC(C1(CCCC1)N)F
  9. (1-(difluoromethyl)cyclopentyl)methanol

    CAS No.: 1780516-53-1
    Catalog No.: TQU0058
    Purity: 95%
    MF: C7H12F2O
    MW: 150.168
    Storage: 2-8 degree Celsius
    SMILES: FC(C1(CCCC1)CO)F
  10. 3-(difluoromethyl)cyclopentanol

    CAS No.: 1780800-27-2
    Catalog No.: TQU0059
    Purity: 95%
    MF: C6H10F2O
    MW: 136.141
    Storage: 2-8 degree Celsius
    SMILES: FC(C1CC(CC1)O)F
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 198 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5