•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cell Cycle

Set Ascending Direction

   

Items 1 to 10 of 73 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. KSQ-4279

    CAS No.: 2446480-97-1
    Catalog No.: 195367
    Purity: 95%
    MF: C27H25F3N8O
    MW: 534.546
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC2=CC=C(C=C2)C=2N(C=C(N2)C(F)(F)F)C(C)C)OC
  2. SNS-032; BMS-387032

    CAS No.: 345627-80-7
    Catalog No.: 109817
    Purity: 95%
    MF: C17H24N4O2S2
    MW: 380.539
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C1=CN=C(CSC2=CN=C(NC(=O)C3CCNCC3)S2)O1
  3. Irinotecan

    CAS No.: 97682-44-5
    Catalog No.: 109777
    Purity: 95%
    MF: C33H38N4O6
    MW: 586.689
    Storage: 2-8 degree Celsius
    SMILES: CCC1=C2CN3C(=CC4=C(COC(=O)[C@]4(O)CC)C3=O)C2=NC2=CC=C(OC(=O)N3CCC(CC3)N3CCCCC3)C=C12
  4. Pixantrone dimaleate; BBR 2778 dimaleate

    CAS No.: 144675-97-8
    Catalog No.: 108444
    Purity: 95%
    MF: C21H23N5O6
    MW: 441.444
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C/C(O)=O.NCCNC1=C2C(=O)C3=C(C=NC=C3)C(=O)C2=C(NCCN)C=C1
  5. Palbociclib (PD-0332991; PD 0332991) HCl

    CAS No.: 827022-32-2
    Catalog No.: 105140
    Purity: 95%
    MF: C24H30ClN7O2
    MW: 484.004
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CC(=O)C1=C(C)C2=CN=C(NC3=NC=C(C=C3)N3CCNCC3)N=C2N(C2CCCC2)C1=O
  6. Danusertib; PHA-739358

    CAS No.: 827318-97-8
    Catalog No.: 104825
    Purity: 95%
    MF: C26H30N6O3
    MW: 474.565
    Storage: 2-8 degree Celsius
    SMILES: CO[C@@H](C(=O)N1CC2=C(C1)C(NC(=O)C1=CC=C(C=C1)N1CCN(C)CC1)=NN2)C1=CC=CC=C1
  7. TAK-901

    CAS No.: 934541-31-8
    Catalog No.: 104816
    Purity: 95%
    MF: C28H32N4O3S
    MW: 504.656
    Storage: 2-8 degree Celsius
    SMILES: CCS(=O)(=O)C1=CC(=CC=C1)C1=CC(C(=O)NC2CCN(C)CC2)=C(C)C2=C1C1=CC(C)=CN=C1N2
  8. MK-1775; AZD1775

    CAS No.: 955365-80-7
    Catalog No.: 101254
    Purity: 95%
    MF: C27H32N8O2
    MW: 500.607
    Storage: 2-8 degree Celsius
    SMILES: CN1CCN(CC1)C1=CC=C(NC2=NC=C3C(=O)N(CC=C)N(C3=N2)C2=NC(=CC=C2)C(C)(C)O)C=C1
  9. Y-27632 2HCl

    CAS No.: 129830-38-2
    Catalog No.: 101140
    Purity: 95%
    MF: C14H23Cl2N3O
    MW: 320.264
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].Cl[H].C[C@@H](N)[C@H]1CC[C@@H](CC1)C(=O)NC1=CC=NC=C1
  10. Exatecan

    CAS No.: 171335-80-1
    Catalog No.: WLZ1465
    Purity: 95%
    MF: C24H22FN3O4
    MW: 435.455
    Storage: 2-8 degree Celsius
    SMILES: O=C1[C@@](CC)(O)C2=C(CO1)C(N3CC4=C5C6=C(CC[C@@H]5N)C(C)=C(F)C=C6N=C4C3=C2)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 73 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5