•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Carbazoles

Set Ascending Direction

   

Items 31 to 36 of 36 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 9H-carbazol-4-ol

    CAS No.: 52602-39-8
    Catalog No.: 177929
    Purity: 95%
    MF: C12H9NO
    MW: 183.21
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC=CC2=C1C1=CC=CC=C1N2
  2. 5H-benzofuro[3,2-c]carbazole

    CAS No.: 1199616-66-4
    Catalog No.: 178122
    Purity: 95%
    MF: C18H11NO
    MW: 257.292
    Storage: 2-8 degree Celsius
    SMILES: N1C2=C(C=CC=C2)C2=C1C=CC1=C2OC2=CC=CC=C12
  3. 11,11-dimethyl-5,11-dihydroindeno[1,2-b]carbazole

    CAS No.: 1260228-95-2
    Catalog No.: 178130
    Purity: 95%
    MF: C21H17N
    MW: 283.374
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)C2=CC=CC=C2C2=CC3=C(C=C12)C1=CC=CC=C1N3
  4. 9H-carbazole-2-carbonitrile

    CAS No.: 57955-18-7
    Catalog No.: 199263
    Purity: 95%
    MF: C13H8N2
    MW: 192.221
    Storage: 2-8 degree Celsius
    SMILES: C1=C(C=CC=2C3=CC=CC=C3NC12)C#N
  5. 2-(9H-carbazol-9-yl)acetic acid

    CAS No.: 524-80-1
    Catalog No.: 195508
    Purity: 95%
    MF: C14H11NO2
    MW: 225.247
    Storage: 2-8 degree Celsius
    SMILES: C1=CC=CC=2C3=CC=CC=C3N(C12)CC(=O)O
  6. 3-iodo-N-phenylcarbazole

    CAS No.: 502161-03-7
    Catalog No.: 101168
    Purity: 95%
    MF: C18H12IN
    MW: 369.205
    Storage: 2-8 degree Celsius
    SMILES: IC1=CC2=C(C=C1)N(C1=C2C=CC=C1)C1=CC=CC=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 36 of 36 total

  1. 1
  2. 2
  3. 3
  4. 4