•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Carbazoles

Set Ascending Direction

   

Items 1 to 10 of 36 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 3,4-dihydro-1H-carbazol-2(9H)-one

    CAS No.: 40429-00-3
    Catalog No.: 106280
    Purity: 95%
    MF: C12H11NO
    MW: 185.226
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCC2=C(C1)NC1=C2C=CC=C1
  2. 3,6-dibromocarbazole

    CAS No.: 6825-20-3
    Catalog No.: 113598
    Purity: 95%
    MF: C12H7Br2N
    MW: 325.003
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(NC3=C2C=C(Br)C=C3)C=C1
  3. 6-bromo-3-(dimethylamino)-1,2,3,4-tetrahydro-9h-carbazole

    CAS No.: 186545-33-5
    Catalog No.: 133757
    Purity: 95%
    MF: C14H17BrN2
    MW: 293.208
    Storage: 2-8 degree Celsius
    SMILES: CN(C)C1CCC2=C(C1)C1=CC(Br)=CC=C1N2
  4. (3R)-3-(methylamino)-2,3,4,4a,9,9a-hexahydro-1H-carbazole-6-carboxamide

    CAS No.: 158747-02-5
    Catalog No.: 159062
    Purity: 95%
    MF: C14H19N3O
    MW: 245.326
    Storage: 2-8 degree Celsius
    SMILES: CN[C@@H]1CCC2NC3=CC=C(C=C3C2C1)C(N)=O
  5. 14H-benzo[c]benzo[4,5]thieno[2,3-a]carbazole

    CAS No.: 1313395-18-4
    Catalog No.: 152681
    Purity: 95%
    MF: C22H13NS
    MW: 323.42
    Storage: 2-8 degree Celsius
    SMILES: N1C2=C(C=CC=C2)C2=C1C1=C(C3=CC=CC=C3S1)C1=CC=CC=C21
  6. 3,6-dichloro-1-nitro-9H-carbazole

    CAS No.: 100125-26-6
    Catalog No.: 193635
    Purity: 95%
    MF: C12H6Cl2N2O2
    MW: 281.098
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=2NC3=CC=C(C=C3C2C1)Cl)[N+](=O)[O-]
  7. 6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-2-amine

    CAS No.: 907211-97-6
    Catalog No.: 101363
    Purity: 95%
    MF: C12H13FN2
    MW: 204.248
    Storage: 2-8 degree Celsius
    SMILES: NC1CCC2=C(C1)NC1=C2C=C(F)C=C1
  8. 5,7-dihydroindolo[2,3-b]carbazole

    CAS No.: 111296-90-3
    Catalog No.: 105784
    Purity: 95%
    MF: C18H12N2
    MW: 256.308
    Storage: 2-8 degree Celsius
    SMILES: N1C2=CC3=C(C=C2C2=C1C=CC=C2)C1=C(N3)C=CC=C1
  9. 11,12-dihydroindolo[2,3-a]carbazole

    CAS No.: 60511-85-5
    Catalog No.: 105951
    Purity: 95%
    MF: C18H12N2
    MW: 256.308
    Storage: 2-8 degree Celsius
    SMILES: N1C2=C(C=CC=C2)C2=C1C1=C(C=C2)C2=C(N1)C=CC=C2
  10. (2-(9H-carbazol-9-yl)phenyl)boronic acid

    CAS No.: 1189047-28-6
    Catalog No.: 159676
    Purity: 95%
    MF: C18H14BNO2
    MW: 287.127
    Storage: 2-8 degree Celsius
    SMILES: OB(O)C1=C(C=CC=C1)N1C2=CC=CC=C2C2=C1C=CC=C2
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 36 total

  1. 1
  2. 2
  3. 3
  4. 4