•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Building Blocks

Set Ascending Direction

   

Items 31 to 40 of 31798 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 2-aminopyridine-4-sulfonamide hydrochloride

    CAS No.: 2137792-99-3
    Catalog No.: GS1273
    Purity: 95%
    MF: C5H8ClN3O2S
    MW: 209.658
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC1=NC=CC(=C1)S(=O)(=O)N
  2. 2-aminopyridine-4-sulfonamide

    CAS No.: 1248057-21-7
    Catalog No.: GS1272
    Purity: 95%
    MF: C5H7N3O2S
    MW: 173.197
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=CC(=C1)S(=O)(=O)N
  3. 3-bromo-5-hydroxybenzenesulfonamide

    CAS No.: 1243365-25-4
    Catalog No.: GS1066
    Purity: 95%
    MF: C6H6BrNO3S
    MW: 252.089
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C=C(C1)O)S(=O)(=O)N
  4. 4-(azetidin-3-yl)aniline dihydrochloride

    CAS No.: 90533-74-7
    Catalog No.: GS0576
    Purity: 95%
    MF: C9H14Cl2N2
    MW: 221.131
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.N1CC(C1)C1=CC=C(N)C=C1
  5. 3-(3-(trifluoromethoxy)phenyl)azetidine hydrochloride

    CAS No.: 1956377-45-9
    Catalog No.: GS0551
    Purity: 95%
    MF: C10H11ClF3NO
    MW: 253.651
    Storage: 2-8 degree Celsius
    SMILES: Cl.FC(OC=1C=C(C=CC1)C1CNC1)(F)F
  6. 3-(4-bromophenyl)azetidine

    CAS No.: 7215-01-2
    Catalog No.: GS0564
    Purity: 95%
    MF: C9H10BrN
    MW: 212.09
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1CNC1
  7. 3-(4-bromophenyl)azetidine hydrochloride

    CAS No.: 90561-74-3
    Catalog No.: GS0565
    Purity: 95%
    MF: C9H11BrClN
    MW: 248.551
    Storage: 2-8 degree Celsius
    SMILES: Cl.BrC1=CC=C(C=C1)C1CNC1
  8. 4-(azetidin-3-yl)aniline

    CAS No.: 7215-04-5
    Catalog No.: GS0575
    Purity: 95%
    MF: C9H12N2
    MW: 148.209
    Storage: 2-8 degree Celsius
    SMILES: N1CC(C1)C1=CC=C(N)C=C1
  9. 3-(4-(trifluoromethoxy)phenyl)azetidine hydrochloride

    CAS No.: 1956331-83-1
    Catalog No.: GS0582
    Purity: 95%
    MF: C10H11ClF3NO
    MW: 253.651
    Storage: 2-8 degree Celsius
    SMILES: Cl.FC(OC1=CC=C(C=C1)C1CNC1)(F)F
  10. 2-(azetidin-3-yl)-5-methoxypyridine

    CAS No.: 1260812-61-0
    Catalog No.: GS0630
    Purity: 95%
    MF: C9H12N2O
    MW: 164.208
    Storage: 2-8 degree Celsius
    SMILES: N1CC(C1)C1=NC=C(C=C1)OC
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 31798 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6