•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Bicycloes

Set Ascending Direction

   

Items 41 to 50 of 69 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. methyl 4-((tert-butoxycarbonyl)amino)bicyclo[2.2.1]heptane-1-carboxylate

    CAS No.: 1201186-85-7
    Catalog No.: 195876
    Purity: 95%
    MF: C14H23NO4
    MW: 269.341
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)NC12CCC(CC1)(C2)C(=O)OC
  2. bicyclo[2.2.2]octan-1-amine hydrochloride

    CAS No.: 1193-43-7
    Catalog No.: 195875
    Purity: 95%
    MF: C8H16ClN
    MW: 161.676
    Storage: 2-8 degree Celsius
    SMILES: Cl.C12(CCC(CC1)CC2)N
  3. bicyclo[3.1.0]hexan-3-ol

    CAS No.: 89489-26-9
    Catalog No.: 191668
    Purity: 95%
    MF: C6H10O
    MW: 98.145
    Storage: 2-8 degree Celsius
    SMILES: C12CC(CC2C1)O
  4. 3-(difluoromethyl)bicyclo[1.1.1]pentane-1-carboxylic acid

    CAS No.: 2090481-18-6
    Catalog No.: TQU0044
    Purity: 95%
    MF: C7H8F2O2
    MW: 162.135
    Storage: 2-8 degree Celsius
    SMILES: FC(C12CC(C1)(C2)C(=O)O)F
  5. methyl 2-(3-((tert-butoxycarbonyl)amino)bicyclo[1.1.1]pentan-1-yl)acetate

    CAS No.: 1995848-08-2
    Catalog No.: 195881
    Purity: 95%
    MF: C13H21NO4
    MW: 255.314
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)NC12CC(C1)(C2)CC(=O)OC
  6. 1-(difluoromethyl)-3-iodobicyclo[1.1.1]pentane

    CAS No.: 2363075-15-2
    Catalog No.: TQU0042
    Purity: 95%
    MF: C6H7F2I
    MW: 244.022
    Storage: 2-8 degree Celsius
    SMILES: FC(C12CC(C1)(C2)I)F
  7. methyl 3-(difluoromethyl)bicyclo[1.1.1]pentane-1-carboxylate

    CAS No.: 2363075-05-0
    Catalog No.: TQU0041
    Purity: 95%
    MF: C8H10F2O2
    MW: 176.162
    Storage: 2-8 degree Celsius
    SMILES: FC(C12CC(C1)(C2)C(=O)OC)F
  8. 6-(bicyclo[2.2.1]heptan-2-yl)-1-hydroxy-4-methylpyridin-2(1H)-one

    CAS No.: 79438-21-4
    Catalog No.: TQR1464
    Purity: 95%
    MF: C13H17NO2
    MW: 219.284
    Storage: 2-8 degree Celsius
    SMILES: C12C(CC(CC1)C2)C2=CC(=CC(N2O)=O)C
  9. tert-butyl ((3aS,7aR)-hexahydropyrano[3,4-c]pyrrol-3a(4H)-yl)carbamate

    CAS No.: 1037368-67-4
    Catalog No.: TQP0822
    Purity: 95%
    MF: C12H22N2O3
    MW: 242.319
    Storage: 2-8 degree Celsius
    SMILES: C1[C@@H]2[C@](CN1)(COCC2)NC(OC(C)(C)C)=O
  10. tert-butyl ((3aS,7aS)-hexahydropyrano[3,4-c]pyrrol-3a(4H)-yl)carbamate

    CAS No.: 1037368-68-5
    Catalog No.: TQP0821
    Purity: 95%
    MF: C12H22N2O3
    MW: 242.319
    Storage: 2-8 degree Celsius
    SMILES: C1[C@@H]2[C@](CN1)(COCC2)NC(OC(C)(C)C)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 69 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7