•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Bicycloes

Set Ascending Direction

   

Items 31 to 40 of 69 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. methyl 3-aminobicyclo[1.1.1]pentane-1-carboxylate

    CAS No.: 758684-88-7
    Catalog No.: 193451
    Purity: 95%
    MF: C7H11NO2
    MW: 141.17
    Storage: 2-8 degree Celsius
    SMILES: NC12CC(C1)(C2)C(=O)OC
  2. (1R,2R,3R,6S)-3-isopropyl-6-methyl-7-oxabicyclo[4.1.0]heptan-2-ol

    CAS No.: 103476-53-5
    Catalog No.: 192444
    Purity: 95%
    MF: C10H18O2
    MW: 170.252
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)[C@@H]1[C@H]([C@H]2O[C@]2(CC1)C)O
  3. methyl 3-formylbicyclo[1.1.1]pentane-1-carboxylate

    CAS No.: 180464-92-0
    Catalog No.: 182903
    Purity: 95%
    MF: C8H10O3
    MW: 154.165
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C12CC(C1)(C2)C=O
  4. 3-(((tert-butyldimethylsilyl)oxy)methyl)bicyclo[1.1.1]pentane-1-carbaldehyde

    CAS No.: 2136607-41-3
    Catalog No.: 182902
    Purity: 95%
    MF: C13H24O2Si
    MW: 240.419
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)[Si](C)(C)OCC12CC(C1)(C2)C=O
  5. tert-butyl (3-formylbicyclo[1.1.1]pentan-1-yl)carbamate

    CAS No.: 1638771-06-8
    Catalog No.: 182899
    Purity: 95%
    MF: C11H17NO3
    MW: 211.261
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC12CC(C1)(C2)C=O
  6. 3-(difluoromethyl)bicyclo[1.1.1]pentan-1-amine hydrochloride

    CAS No.: 2108549-79-5
    Catalog No.: TQU0043
    Purity: 95%
    MF: C6H10ClF2N
    MW: 169.602
    Storage: 2-8 degree Celsius
    SMILES: Cl.FC(C12CC(C1)(C2)N)F
  7. (3-aminobicyclo[1.1.1]pentan-1-yl)methanol

    CAS No.: 1638767-26-6
    Catalog No.: 195880
    Purity: 95%
    MF: C6H11NO
    MW: 113.16
    Storage: 2-8 degree Celsius
    SMILES: NC12CC(C1)(C2)CO
  8. 4-((tert-butoxycarbonyl)amino)bicyclo[2.2.1]heptane-1-carboxylic acid

    CAS No.: 1201186-86-8
    Catalog No.: 195879
    Purity: 95%
    MF: C13H21NO4
    MW: 255.314
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)NC12CCC(CC1)(C2)C(=O)O
  9. bicyclo[1.1.1]pentane-1,3-diol

    CAS No.: 1312790-52-5
    Catalog No.: 195878
    Purity: 95%
    MF: C5H8O2
    MW: 100.117
    Storage: 2-8 degree Celsius
    SMILES: C12(CC(C1)(C2)O)O
  10. 4-(aminomethyl)bicyclo[2.2.1]heptane-1-carboxylic acid hydrochloride

    CAS No.: 28333-76-8
    Catalog No.: 195877
    Purity: 95%
    MF: C9H16ClNO2
    MW: 205.685
    Storage: 2-8 degree Celsius
    SMILES: Cl.NCC12CCC(CC1)(C2)C(=O)O
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 69 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6