•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzoxazoles

Set Ascending Direction

   

Items 31 to 40 of 98 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 5-(2-chloro-5-methylpyrimidin-4-ylamino)benzo[d]oxazol-2(3H)-one

    CAS No.: 1236670-87-3
    Catalog No.: 104602
    Purity: 95%
    MF: C12H9ClN4O2
    MW: 276.683
    Storage: 2-8 degree Celsius
    SMILES: CC1=CN=C(Cl)N=C1NC1=CC=C2OC(=O)NC2=C1
  2. 5-chlorobenzo[d]oxazol-7-amine

    CAS No.: 1225672-06-9
    Catalog No.: 125846
    Purity: 95%
    MF: C7H5ClN2O
    MW: 168.583
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2OC=NC2=CC(Cl)=C1
  3. 2-aminobenzo[d]oxazol-5-ylboronic acid hydrochloride

    CAS No.: 1404480-15-4
    Catalog No.: 124887
    Purity: 95%
    MF: C7H8BClN2O3
    MW: 214.417
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].NC1=NC2=CC(=CC=C2O1)B(O)O
  4. 2-phenylbenzo[d]oxazol-6-amine

    CAS No.: 53421-88-8
    Catalog No.: TQP2219
    Purity: 95%
    MF: C13H10N2O
    MW: 210.236
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C=1OC2=C(N1)C=CC(=C2)N
  5. 2-(4-ethylphenyl)benzo[d]oxazol-5-amine

    CAS No.: 116248-09-0
    Catalog No.: TQP2217
    Purity: 95%
    MF: C15H14N2O
    MW: 238.29
    Storage: 2-8 degree Celsius
    SMILES: C(C)C1=CC=C(C=C1)C=1OC2=C(N1)C=C(C=C2)N
  6. 6-bromo-5-fluorobenzo[d]oxazol-2(3H)-one

    CAS No.: 944805-23-6
    Catalog No.: TQP0557
    Purity: 95%
    MF: C7H3BrFNO2
    MW: 232.008
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(NC(O2)=O)C=C1F
  7. methyl 2-aminobenzo[d]oxazole-6-carboxylate

    CAS No.: 851075-63-3
    Catalog No.: 199848
    Purity: 95%
    MF: C9H8N2O3
    MW: 192.174
    Storage: 2-8 degree Celsius
    SMILES: NC=1OC2=C(N1)C=CC(=C2)C(=O)OC
  8. 2-(p-tolyl)benzo[d]oxazol-5-amine

    CAS No.: 54995-50-5
    Catalog No.: TQP2223
    Purity: 95%
    MF: C14H12N2O
    MW: 224.263
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=C(C=C1)C=1OC2=C(N1)C=C(C=C2)N)C
  9. 6-chloro-1-methyl-1H-benzo[d][1,3]oxazine-2,4-dione

    CAS No.: 14529-12-5
    Catalog No.: 141139
    Purity: 95%
    MF: C9H6ClNO3
    MW: 211.604
    Storage: 2-8 degree Celsius
    SMILES: CN1C(=O)OC(=O)C2=C1C=CC(Cl)=C2
  10. 6-chloro-1H-benzo[d][1,3]oxazine-2,4-dione

    CAS No.: 4743-17-3
    Catalog No.: 141138
    Purity: 95%
    MF: C8H4ClNO3
    MW: 197.577
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(NC(=O)OC2=O)C=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 98 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6