•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzotriazines

Set Ascending Direction

   

Items 21 to 30 of 53 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-chloro-7-(ethoxycarbonyl)benzo[e][1,2,4]triazine 1-oxide

    CAS No.: 7030-31-1
    Catalog No.: TQP2582
    Purity: 95%
    MF: C10H8ClN3O3
    MW: 253.645
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=CC(=C2)C(=O)OCC)[O-]
  2. 3-chloro-7,8-dihydrobenzofuro[6,5-e][1,2,4]triazine 1-oxide

    CAS No.: 911299-91-7
    Catalog No.: TQP2583
    Purity: 95%
    MF: C9H6ClN3O2
    MW: 223.619
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=C1C(CCO1)=C2)[O-]
  3. 3-chlorobenzo[e][1,2,4]triazine

    CAS No.: 91669-21-5
    Catalog No.: TQP0599
    Purity: 95%
    MF: C7H4ClN3
    MW: 165.583
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=NC2=C(N1)C=CC=C2
  4. 7-bromo-3-chlorobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 70373-18-1
    Catalog No.: TQP2568
    Purity: 95%
    MF: C7H3BrClN3O
    MW: 260.478
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(N=C(N=[N+]2[O-])Cl)C=C1
  5. 7-bromo-3-chlorobenzo[e][1,2,4]triazine

    CAS No.: 78689-28-8
    Catalog No.: TQP0602
    Purity: 95%
    MF: C7H3BrClN3
    MW: 244.479
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(N=C(N=N2)Cl)C=C1
  6. 3-methylbenzo[e][1,2,4]triazine

    CAS No.: 6299-94-1
    Catalog No.: 106005
    Purity: 95%
    MF: C8H7N3
    MW: 145.165
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC2=CC=CC=C2N=N1
  7. 3-amino-7-bromobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 6298-38-0
    Catalog No.: 190082
    Purity: 95%
    MF: C7H5BrN4O
    MW: 241.048
    Storage: 2-8 degree Celsius
    SMILES: NC=1N=[N+](C2=C(N1)C=CC(=C2)Br)[O-]
  8. 6-methoxy-3-phenylbenzo[e][1,2,4]triazine

    CAS No.: 100726-28-1
    Catalog No.: TQP0595
    Purity: 95%
    MF: C14H11N3O
    MW: 237.262
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=CC2=C(N=C(N=N2)C2=CC=CC=C2)C1
  9. 3-ethylbenzo[e][1,2,4]triazine

    CAS No.: 62595-80-6
    Catalog No.: TQP0583
    Purity: 95%
    MF: C9H9N3
    MW: 159.192
    Storage: 2-8 degree Celsius
    SMILES: C(C)C=1N=NC2=C(N1)C=CC=C2
  10. 3,6-dimethylbenzo[e][1,2,4]triazine

    CAS No.: 99358-42-6
    Catalog No.: TQP0584
    Purity: 95%
    MF: C9H9N3
    MW: 159.192
    Storage: 2-8 degree Celsius
    SMILES: CC=1N=NC2=C(N1)C=C(C=C2)C
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 53 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5