•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzothiazines

Set Ascending Direction

   

Items 1 to 10 of 27 total

  1. 1
  2. 2
  3. 3
  1. 7-chloro-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 110654-51-8
    Catalog No.: TQP2050
    Purity: 95%
    MF: C8H8ClNO2S
    MW: 217.677
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(CNS(C2)(=O)=O)C=C1
  2. 7-chloro-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 5800-59-9
    Catalog No.: 150939
    Purity: 95%
    MF: C7H5ClN2O3S
    MW: 232.648
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(NC(=O)NS2(=O)=O)C=C1
  3. 3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 33183-87-8
    Catalog No.: 133090
    Purity: 95%
    MF: C8H9NO2S
    MW: 183.232
    Storage: 2-8 degree Celsius
    SMILES: O=S1(=O)CC2=CC=CC=C2CN1
  4. Diazoxide

    CAS No.: 364-98-7
    Catalog No.: 189444
    Purity: 95%
    MF: C8H7ClN2O2S
    MW: 230.676
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(N=C(NS2(=O)=O)C)C=C1
  5. 6-chloro-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 1672-20-4
    Catalog No.: 135786
    Purity: 95%
    MF: C7H5ClN2O3S
    MW: 232.648
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(C=C1)S(=O)(=O)NC(=O)N2
  6. 6-(hydroxymethyl)-2h-benzo[b][1,4]thiazin-3(4h)-one

    CAS No.: 443955-31-5
    Catalog No.: 102113
    Purity: 95%
    MF: C9H9NO2S
    MW: 195.243
    Storage: 2-8 degree Celsius
    SMILES: OCC1=CC=C2SCC(=O)NC2=C1
  7. 7-chloro-3-methyl-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide

    CAS No.: 22503-72-6
    Catalog No.: 101591
    Purity: 95%
    MF: C8H9ClN2O2S
    MW: 232.692
    Storage: 2-8 degree Celsius
    SMILES: CC1NC2=CC=C(Cl)C=C2S(=O)(=O)N1
  8. 8-chloro-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 110654-50-7
    Catalog No.: TQP2057
    Purity: 95%
    MF: C8H8ClNO2S
    MW: 217.677
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=CC=2CNS(CC21)(=O)=O
  9. 6-nitro-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 110654-59-6
    Catalog No.: TQP2056
    Purity: 95%
    MF: C8H8N2O4S
    MW: 228.229
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C=1C=CC2=C(CNS(C2)(=O)=O)C1
  10. 6-amino-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 1704494-33-6
    Catalog No.: TQP2055
    Purity: 95%
    MF: C8H10N2O2S
    MW: 198.247
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=CC2=C(CNS(C2)(=O)=O)C1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 27 total

  1. 1
  2. 2
  3. 3