•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzodioxoles

Set Ascending Direction

   

Items 31 to 40 of 53 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. (S)-3-(benzo[d][1,3]dioxol-5-yl)-3-((tert-butoxycarbonyl)amino)propanoic acid

    CAS No.: 162240-67-7
    Catalog No.: TQR0340
    Purity: 95%
    MF: C15H19NO6
    MW: 309.318
    Storage: 2-8 degree Celsius
    SMILES: O1COC2=C1C=CC(=C2)[C@H](CC(=O)O)NC(=O)OC(C)(C)C
  2. 6-ethylbenzo[d][1,3]dioxol-5-amine

    CAS No.: 549548-16-5
    Catalog No.: TQR1172
    Purity: 95%
    MF: C9H11NO2
    MW: 165.192
    Storage: 2-8 degree Celsius
    SMILES: C(C)C=1C(=CC2=C(OCO2)C1)N
  3. 1-(6-ethylbenzo[d][1,3]dioxol-5-yl)piperazine

    CAS No.: 2378642-78-3
    Catalog No.: TQR1173
    Purity: 95%
    MF: C13H18N2O2
    MW: 234.299
    Storage: 2-8 degree Celsius
    SMILES: C(C)C=1C(=CC2=C(OCO2)C1)N1CCNCC1
  4. 3-(benzo[d][1,3]dioxol-5-yl)-7-hydroxy-4H-chromen-4-one

    CAS No.: 90-29-9
    Catalog No.: TQR1708
    Purity: 95%
    MF: C16H10O5
    MW: 282.251
    Storage: 2-8 degree Celsius
    SMILES: O1COC2=C1C=CC(=C2)C2=COC1=CC(=CC=C1C2=O)O
  5. 6-(benzo[d][1,3]dioxol-5-yl)-4-oxo-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile

    CAS No.: 95566-90-8
    Catalog No.: TQR966
    Purity: 95%
    MF: C12H7N3O3S
    MW: 273.273
    Storage: 2-8 degree Celsius
    SMILES: O1COC2=C1C=CC(=C2)C2=C(C(NC(N2)=S)=O)C#N
  6. benzo[d][1,3]dioxol-5-ylboronic acid

    CAS No.: 94839-07-3
    Catalog No.: 107740
    Purity: 95%
    MF: C7H7BO4
    MW: 165.941
    Storage: 2-8 degree Celsius
    SMILES: OB(O)C1=CC=C2OCOC2=C1
  7. 5-isocyanatobenzo[d][1,3]dioxole

    CAS No.: 69922-28-7
    Catalog No.: 107845
    Purity: 95%
    MF: C8H5NO3
    MW: 163.132
    Storage: 2-8 degree Celsius
    SMILES: O=C=NC1=CC=C2OCOC2=C1
  8. benzo[d][1,3]dioxole-4-carbaldehyde

    CAS No.: 7797-83-3
    Catalog No.: 107863
    Purity: 95%
    MF: C8H6O3
    MW: 150.133
    Storage: 2-8 degree Celsius
    SMILES: O=CC1=C2OCOC2=CC=C1
  9. 2,2-difluoro-2H-1,3-benzodioxole-4-carbaldehyde

    CAS No.: 119895-68-0
    Catalog No.: 171480
    Purity: 95%
    MF: C8H4F2O3
    MW: 186.113
    Storage: 2-8 degree Celsius
    SMILES: FC1(F)OC2=C(O1)C(C=O)=CC=C2
  10. methyl 6-aminobenzo[d][1,3]dioxole-5-carboxylate

    CAS No.: 40680-63-5
    Catalog No.: 199226
    Purity: 95%
    MF: C9H9NO4
    MW: 195.174
    Storage: 2-8 degree Celsius
    SMILES: NC=1C(=CC2=C(OCO2)C1)C(=O)OC
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 53 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6