•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzodioxoles

Set Ascending Direction

   

Items 21 to 30 of 53 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (R)-1-(benzo[d][1,3]dioxol-5-yl)ethanamine

    CAS No.: 210488-54-3
    Catalog No.: 106172
    Purity: 95%
    MF: C9H11NO2
    MW: 165.192
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H](N)C1=CC=C2OCOC2=C1
  2. 1-trifluoromethyl-1,2-benziodoxol-3(1H)-one

    CAS No.: 887144-94-7
    Catalog No.: 102145
    Purity: 95%
    MF: C8H6F3IO2
    MW: 318.032
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)[I]1OC(=O)C2=CC=CC=C12
  3. 2-(benzo[d][1,3]dioxol-5-yl)acetic acid

    CAS No.: 2861-28-1
    Catalog No.: 106595
    Purity: 95%
    MF: C9H8O4
    MW: 180.159
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)CC1=CC=C2OCOC2=C1
  4. 5-iodobenzo[d][1,3]dioxole

    CAS No.: 5876-51-7
    Catalog No.: 129302
    Purity: 95%
    MF: C7H5IO2
    MW: 248.019
    Storage: 2-8 degree Celsius
    SMILES: IC1=CC2=C(OCO2)C=C1
  5. 1,3-benzodioxole-4-acetic acid

    CAS No.: 100077-49-4
    Catalog No.: 186788
    Purity: 95%
    MF: C9H8O4
    MW: 180.159
    Storage: 2-8 degree Celsius
    SMILES: O1COC2=C1C=CC=C2CC(=O)O
  6. 1-(2,2-difluorobenzo[d][1,3]dioxol-5-yl)-N-(1-methyl-1H-indol-5-yl)cyclopropanecarboxamide

    CAS No.: NA
    Catalog No.: 187315
    Purity: 95%
    MF: C20H16F2N2O3
    MW: 370.355
    Storage: 2-8 degree Celsius
    SMILES: FC1(OC2=C(O1)C=CC(=C2)C2(CC2)C(=O)NC=2C=C1C=CN(C1=CC2)C)F
  7. 5-bromo-2,2-dimethylbenzo[d][1,3]dioxole

    CAS No.: 73790-19-9
    Catalog No.: WLZ2533
    Purity: 95%
    MF: C9H9BrO2
    MW: 229.073
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(OC(O2)(C)C)C=C1
  8. 6-bromo-4-methoxybenzo[d][1,3]dioxole

    CAS No.: 91511-83-0
    Catalog No.: 199288
    Purity: 95%
    MF: C8H7BrO3
    MW: 231.045
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C2=C(OCO2)C1)OC
  9. 7-methoxybenzo[d][1,3]dioxole-5-carboxylic acid

    CAS No.: 526-34-1
    Catalog No.: TQP0783
    Purity: 95%
    MF: C9H8O5
    MW: 196.158
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC(=CC2=C1OCO2)C(=O)O
  10. 2-(4-bromo-7-methoxybenzo[d][1,3]dioxol-5-yl)ethanamine hydrochloride

    CAS No.: 1238220-34-2
    Catalog No.: TQP0950
    Purity: 95%
    MF: C10H13BrClNO3
    MW: 310.575
    Storage: 2-8 degree Celsius
    SMILES: Cl.BrC1=C(C=C(C=2OCOC21)OC)CCN
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 53 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5