•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzodioxoles

Set Ascending Direction

   

Items 1 to 10 of 53 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Aristolochic acid C

    CAS No.: 4849-90-5
    Catalog No.: 191372
    Purity: 95%
    MF: C16H9NO7
    MW: 327.248
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC=2C3=C(C(=CC2C=C1)[N+](=O)[O-])C(=CC=1OCOC13)C(=O)O
  2. 4-(benzo[d][1,3]dioxol-5-yl)piperidin-4-ol

    CAS No.: 56074-28-3
    Catalog No.: TQP2060
    Purity: 95%
    MF: C12H15NO3
    MW: 221.256
    Storage: 2-8 degree Celsius
    SMILES: O1COC2=C1C=CC(=C2)C2(CCNCC2)O
  3. (S)-2-((tert-butoxycarbonyl)amino)-3-(2,2-dimethylbenzo[d][1,3]dioxol-5-yl)propanoic acid

    CAS No.: 1089705-85-0
    Catalog No.: TQP2525
    Purity: 95%
    MF: C17H23NO6
    MW: 337.372
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N[C@H](C(=O)O)CC1=CC2=C(OC(O2)(C)C)C=C1
  4. (R)-3-(benzo[d][1,3]dioxol-5-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid

    CAS No.: 1150659-42-9
    Catalog No.: TQP2526
    Purity: 95%
    MF: C15H19NO6
    MW: 309.318
    Storage: 2-8 degree Celsius
    SMILES: O1COC2=C1C=CC(=C2)C[C@H](C(=O)O)NC(=O)OC(C)(C)C
  5. (S)-2-((tert-butoxycarbonyl)amino)-3-(2,2-difluorobenzo[d][1,3]dioxol-5-yl)propanoic acid

    CAS No.: 1089705-74-7
    Catalog No.: TQP2527
    Purity: 95%
    MF: C15H17F2NO6
    MW: 345.298
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N[C@H](C(=O)O)CC1=CC2=C(OC(O2)(F)F)C=C1
  6. (R)-2-amino-3-(benzo[d][1,3]dioxol-5-yl)propanoic acid

    CAS No.: 37002-51-0
    Catalog No.: TQP2529
    Purity: 95%
    MF: C10H11NO4
    MW: 209.201
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H](C(=O)O)CC1=CC2=C(OCO2)C=C1
  7. (R)-2-acetamido-3-(benzo[d][1,3]dioxol-5-yl)propanoic acid

    CAS No.: 55629-70-4
    Catalog No.: TQP2530
    Purity: 95%
    MF: C12H13NO5
    MW: 251.238
    Storage: 2-8 degree Celsius
    SMILES: C(C)(=O)N[C@@H](C(=O)O)CC1=CC2=C(OCO2)C=C1
  8. 2-(4-(benzo[d][1,3]dioxol-5-ylmethyl)piperazin-1-yl)pyrimidin-4-amine

    CAS No.: 3601-76-1
    Catalog No.: TQP2603
    Purity: 95%
    MF: C16H19N5O2
    MW: 313.361
    Storage: 2-8 degree Celsius
    SMILES: O1COC2=C1C=CC(=C2)CN2CCN(CC2)C2=NC=CC(=N2)N
  9. 3,4-methylenedioxy-beta-nitrostyrene

    CAS No.: 1485-00-3
    Catalog No.: 102191
    Purity: 95%
    MF: C9H7NO4
    MW: 193.158
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)\C=C\C1=CC=C2OCOC2=C1
  10. 2,2-dimethylbenzo[d][1,3]dioxol-5-amine

    CAS No.: 6324-89-6
    Catalog No.: 102267
    Purity: 95%
    MF: C9H11NO2
    MW: 165.192
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)OC2=CC=C(N)C=C2O1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 53 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5